C17H22N4O3 — CID 118710733
(1-methyl-6-oxo-3,4-dihydro-2H-pyrimido[2,1-b]quinazolin-8-yl) N-butylcarbamate (PubChem CID 118710733) has the molecular formula C17H22N4O3 and a molecular weight of 330.39 g/mol. Its IUPAC name is (1-methyl-6-oxo-3,4-dihydro-2H-pyrimido[2,1-b]quinazolin-8-yl) N-butylcarbamate.
| Compound Name | (1-methyl-6-oxo-3,4-dihydro-2H-pyrimido[2,1-b]quinazolin-8-yl) N-butylcarbamate |
|---|---|
| PubChem CID | 118710733 |
| Molecular Formula | C17H22N4O3 |
| Molecular Weight | 330.39 g/mol |
| Exact Mass | 330.17 |
| IUPAC Name | (1-methyl-6-oxo-3,4-dihydro-2H-pyrimido[2,1-b]quinazolin-8-yl) N-butylcarbamate |
| SMILES | CCCCNC(=O)Oc1ccc2nc3n(c(=O)c2c1)CCCN3C |
| InChI | InChI=1S/C17H22N4O3/c1-3-4-8-18-17(23)24-12-6-7-14-13(11-12)15(22)21-10-5-9-20(2)16(21)19-14/h6-7,11H,3-5,8-10H2,1-2H3,(H,18,23) |
| InChIKey | XKYMEYUPFFNUPW-UHFFFAOYSA-N |
| XLogP | 2.12 |
| TPSA | 76.46 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 330.39 |
| LogP ≤ 5 | 2.12 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|