C20H28N4O3 — CID 118710734
(1-methyl-6-oxo-3,4-dihydro-2H-pyrimido[2,1-b]quinazolin-8-yl) N-heptylcarbamate (PubChem CID 118710734) has the molecular formula C20H28N4O3 and a molecular weight of 372.47 g/mol. Its IUPAC name is (1-methyl-6-oxo-3,4-dihydro-2H-pyrimido[2,1-b]quinazolin-8-yl) N-heptylcarbamate.
| Compound Name | (1-methyl-6-oxo-3,4-dihydro-2H-pyrimido[2,1-b]quinazolin-8-yl) N-heptylcarbamate |
|---|---|
| PubChem CID | 118710734 |
| Molecular Formula | C20H28N4O3 |
| Molecular Weight | 372.47 g/mol |
| Exact Mass | 372.22 |
| IUPAC Name | (1-methyl-6-oxo-3,4-dihydro-2H-pyrimido[2,1-b]quinazolin-8-yl) N-heptylcarbamate |
| SMILES | CCCCCCCNC(=O)Oc1ccc2nc3n(c(=O)c2c1)CCCN3C |
| InChI | InChI=1S/C20H28N4O3/c1-3-4-5-6-7-11-21-20(26)27-15-9-10-17-16(14-15)18(25)24-13-8-12-23(2)19(24)22-17/h9-10,14H,3-8,11-13H2,1-2H3,(H,21,26) |
| InChIKey | KTFMUWDMOOIEGY-UHFFFAOYSA-N |
| XLogP | 3.30 |
| TPSA | 76.46 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 372.47 |
| LogP ≤ 5 | 3.30 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|