C17H24N4O2 — CID 118710747
(1-methyl-2,3,4,6-tetrahydropyrimido[2,1-b]quinazolin-8-yl) N-butylcarbamate (PubChem CID 118710747) has the molecular formula C17H24N4O2 and a molecular weight of 316.41 g/mol. Its IUPAC name is (1-methyl-2,3,4,6-tetrahydropyrimido[2,1-b]quinazolin-8-yl) N-butylcarbamate.
| Compound Name | (1-methyl-2,3,4,6-tetrahydropyrimido[2,1-b]quinazolin-8-yl) N-butylcarbamate |
|---|---|
| PubChem CID | 118710747 |
| Molecular Formula | C17H24N4O2 |
| Molecular Weight | 316.41 g/mol |
| Exact Mass | 316.19 |
| IUPAC Name | (1-methyl-2,3,4,6-tetrahydropyrimido[2,1-b]quinazolin-8-yl) N-butylcarbamate |
| SMILES | CCCCNC(=O)Oc1ccc2c(c1)CN1CCCN(C)C1=N2 |
| InChI | InChI=1S/C17H24N4O2/c1-3-4-8-18-17(22)23-14-6-7-15-13(11-14)12-21-10-5-9-20(2)16(21)19-15/h6-7,11H,3-5,8-10,12H2,1-2H3,(H,18,22) |
| InChIKey | SYONFHJXDJMXOQ-UHFFFAOYSA-N |
| XLogP | 2.71 |
| TPSA | 57.17 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 316.41 |
| LogP ≤ 5 | 2.71 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|