C20H30N4O2 — CID 118710748
(1-methyl-2,3,4,6-tetrahydropyrimido[2,1-b]quinazolin-8-yl) N-heptylcarbamate (PubChem CID 118710748) has the molecular formula C20H30N4O2 and a molecular weight of 358.49 g/mol. Its IUPAC name is (1-methyl-2,3,4,6-tetrahydropyrimido[2,1-b]quinazolin-8-yl) N-heptylcarbamate.
| Compound Name | (1-methyl-2,3,4,6-tetrahydropyrimido[2,1-b]quinazolin-8-yl) N-heptylcarbamate |
|---|---|
| PubChem CID | 118710748 |
| Molecular Formula | C20H30N4O2 |
| Molecular Weight | 358.49 g/mol |
| Exact Mass | 358.24 |
| IUPAC Name | (1-methyl-2,3,4,6-tetrahydropyrimido[2,1-b]quinazolin-8-yl) N-heptylcarbamate |
| SMILES | CCCCCCCNC(=O)Oc1ccc2c(c1)CN1CCCN(C)C1=N2 |
| InChI | InChI=1S/C20H30N4O2/c1-3-4-5-6-7-11-21-20(25)26-17-9-10-18-16(14-17)15-24-13-8-12-23(2)19(24)22-18/h9-10,14H,3-8,11-13,15H2,1-2H3,(H,21,25) |
| InChIKey | QPNRBRHJXWGYRU-UHFFFAOYSA-N |
| XLogP | 3.88 |
| TPSA | 57.17 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 358.49 |
| LogP ≤ 5 | 3.88 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|