C18H11Cl2N3OS — CID 118710860
6-(4-chlorophenyl)-2-[(4-chlorophenyl)methyl]imidazo[2,1-b][1,3,4]thiadiazole-5-carbaldehyde (PubChem CID 118710860) has the molecular formula C18H11Cl2N3OS and a molecular weight of 388.28 g/mol. Its IUPAC name is 6-(4-chlorophenyl)-2-[(4-chlorophenyl)methyl]imidazo[2,1-b][1,3,4]thiadiazole-5-carbaldehyde.
| Compound Name | 6-(4-chlorophenyl)-2-[(4-chlorophenyl)methyl]imidazo[2,1-b][1,3,4]thiadiazole-5-carbaldehyde |
|---|---|
| PubChem CID | 118710860 |
| Molecular Formula | C18H11Cl2N3OS |
| Molecular Weight | 388.28 g/mol |
| Exact Mass | 387.00 |
| IUPAC Name | 6-(4-chlorophenyl)-2-[(4-chlorophenyl)methyl]imidazo[2,1-b][1,3,4]thiadiazole-5-carbaldehyde |
| SMILES | O=Cc1c(-c2ccc(Cl)cc2)nc2sc(Cc3ccc(Cl)cc3)nn12 |
| InChI | InChI=1S/C18H11Cl2N3OS/c19-13-5-1-11(2-6-13)9-16-22-23-15(10-24)17(21-18(23)25-16)12-3-7-14(20)8-4-12/h1-8,10H,9H2 |
| InChIKey | XRTYWKLKORGNIV-UHFFFAOYSA-N |
| XLogP | 5.17 |
| TPSA | 47.26 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 25 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 388.28 |
| LogP ≤ 5 | 5.17 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|