C19H13ClN4OS2 — CID 118710870
[2-[(4-chlorophenyl)methyl]-6-(4-methoxyphenyl)imidazo[2,1-b][1,3,4]thiadiazol-5-yl] thiocyanate (PubChem CID 118710870) has the molecular formula C19H13ClN4OS2 and a molecular weight of 412.93 g/mol. Its IUPAC name is [2-[(4-chlorophenyl)methyl]-6-(4-methoxyphenyl)imidazo[2,1-b][1,3,4]thiadiazol-5-yl] thiocyanate.
| Compound Name | [2-[(4-chlorophenyl)methyl]-6-(4-methoxyphenyl)imidazo[2,1-b][1,3,4]thiadiazol-5-yl] thiocyanate |
|---|---|
| PubChem CID | 118710870 |
| Molecular Formula | C19H13ClN4OS2 |
| Molecular Weight | 412.93 g/mol |
| Exact Mass | 412.02 |
| IUPAC Name | [2-[(4-chlorophenyl)methyl]-6-(4-methoxyphenyl)imidazo[2,1-b][1,3,4]thiadiazol-5-yl] thiocyanate |
| SMILES | COc1ccc(-c2nc3sc(Cc4ccc(Cl)cc4)nn3c2SC#N)cc1 |
| InChI | InChI=1S/C19H13ClN4OS2/c1-25-15-8-4-13(5-9-15)17-18(26-11-21)24-19(22-17)27-16(23-24)10-12-2-6-14(20)7-3-12/h2-9H,10H2,1H3 |
| InChIKey | NMTMRCQHETXBTP-UHFFFAOYSA-N |
| XLogP | 5.28 |
| TPSA | 63.21 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 27 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 412.93 |
| LogP ≤ 5 | 5.28 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'cyanate_/aminonitrile_/thiocyanate', 'substructure': 'N/A'} |
|---|