About 2-(4-methoxyphenyl)-1-methyl-3-(3-methylphenyl)-6-phenylimidazo[2,1-e]pyrazole
2-(4-methoxyphenyl)-1-methyl-3-(3-methylphenyl)-6-phenylimidazo[2,1-e]pyrazole (PubChem CID 118710917) has the molecular formula C26H23N3O
and a molecular weight of 393.49 g/mol. Its IUPAC name is 2-(4-methoxyphenyl)-1-methyl-3-(3-methylphenyl)-6-phenylimidazo[2,1-e]pyrazole.
Molecular Properties
| Compound Name | 2-(4-methoxyphenyl)-1-methyl-3-(3-methylphenyl)-6-phenylimidazo[2,1-e]pyrazole |
| PubChem CID | 118710917 |
| Molecular Formula | C26H23N3O |
| Molecular Weight | 393.49 g/mol |
| Exact Mass | 393.18 |
| IUPAC Name | 2-(4-methoxyphenyl)-1-methyl-3-(3-methylphenyl)-6-phenylimidazo[2,1-e]pyrazole |
| SMILES | COc1ccc(-c2c(-c3cccc(C)c3)n3nc(-c4ccccc4)cc3n2C)cc1 |
| InChI | InChI=1S/C26H23N3O/c1-18-8-7-11-21(16-18)26-25(20-12-14-22(30-3)15-13-20)28(2)24-17-23(27-29(24)26)19-9-5-4-6-10-19/h4-17H,1-3H3 |
| InChIKey | PSQXKCQHFKQWQP-UHFFFAOYSA-N |
| XLogP | 5.99 |
| TPSA | 31.46 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 30 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 393.49 |
| LogP ≤ 5 | 5.99 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze 2-(4-methoxyphenyl)-1-methyl-3-(3-methylphenyl)-6-phenylimidazo[2,1-e]pyrazole with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-(4-methoxyphenyl)-1-methyl-3-(3-methylphenyl)-6-phenylimidazo[2,1-e]pyrazole?
The IUPAC name of 2-(4-methoxyphenyl)-1-methyl-3-(3-methylphenyl)-6-phenylimidazo[2,1-e]pyrazole (CID 118710917) is 2-(4-methoxyphenyl)-1-methyl-3-(3-methylphenyl)-6-phenylimidazo[2,1-e]pyrazole.
What is the SMILES notation for 2-(4-methoxyphenyl)-1-methyl-3-(3-methylphenyl)-6-phenylimidazo[2,1-e]pyrazole?
The canonical SMILES for 2-(4-methoxyphenyl)-1-methyl-3-(3-methylphenyl)-6-phenylimidazo[2,1-e]pyrazole is COc1ccc(-c2c(-c3cccc(C)c3)n3nc(-c4ccccc4)cc3n2C)cc1.
What is the InChIKey of 2-(4-methoxyphenyl)-1-methyl-3-(3-methylphenyl)-6-phenylimidazo[2,1-e]pyrazole?
The InChIKey is PSQXKCQHFKQWQP-UHFFFAOYSA-N. The full InChI is InChI=1S/C26H23N3O/c1-18-8-7-11-21(16-18)26-25(20-12-14-22(30-3)15-13-20)28(2)24-17-23(27-29(24)26)19-9-5-4-6-10-19/h4-17H,1-3H3.
What are the key properties of 2-(4-methoxyphenyl)-1-methyl-3-(3-methylphenyl)-6-phenylimidazo[2,1-e]pyrazole?
2-(4-methoxyphenyl)-1-methyl-3-(3-methylphenyl)-6-phenylimidazo[2,1-e]pyrazole has a molecular weight of 393.49 g/mol, XLogP of 5.99, 4 rotatable bonds, 0 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 2-(4-methoxyphenyl)-1-methyl-3-(3-methylphenyl)-6-phenylimidazo[2,1-e]pyrazole is sourced from PubChem (CID 118710917), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).