About 3H-pyrazolo[4,5-a]phenanthridin-5-amine
3H-pyrazolo[4,5-a]phenanthridin-5-amine (PubChem CID 118711122) has the molecular formula C14H10N4
and a molecular weight of 234.26 g/mol. Its IUPAC name is 3H-pyrazolo[4,5-a]phenanthridin-5-amine.
Molecular Properties
| Compound Name | 3H-pyrazolo[4,5-a]phenanthridin-5-amine |
| PubChem CID | 118711122 |
| Molecular Formula | C14H10N4 |
| Molecular Weight | 234.26 g/mol |
| Exact Mass | 234.09 |
| IUPAC Name | 3H-pyrazolo[4,5-a]phenanthridin-5-amine |
| SMILES | Nc1cc2[nH]ncc2c2c1ncc1ccccc12 |
| InChI | InChI=1S/C14H10N4/c15-11-5-12-10(7-17-18-12)13-9-4-2-1-3-8(9)6-16-14(11)13/h1-7H,15H2,(H,17,18) |
| InChIKey | BBQHUYUAUGFKRG-UHFFFAOYSA-N |
| XLogP | 2.85 |
| TPSA | 67.59 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | |
| Heavy Atoms | 18 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 234.26 |
| LogP ≤ 5 | 2.85 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'}, {'alert_name': 'Polycyclic_aromatic_hydrocarbon_3', 'substructure': 'N/A'} |
|---|
Analyze 3H-pyrazolo[4,5-a]phenanthridin-5-amine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3H-pyrazolo[4,5-a]phenanthridin-5-amine?
The IUPAC name of 3H-pyrazolo[4,5-a]phenanthridin-5-amine (CID 118711122) is 3H-pyrazolo[4,5-a]phenanthridin-5-amine.
What is the SMILES notation for 3H-pyrazolo[4,5-a]phenanthridin-5-amine?
The canonical SMILES for 3H-pyrazolo[4,5-a]phenanthridin-5-amine is Nc1cc2[nH]ncc2c2c1ncc1ccccc12.
What is the InChIKey of 3H-pyrazolo[4,5-a]phenanthridin-5-amine?
The InChIKey is BBQHUYUAUGFKRG-UHFFFAOYSA-N. The full InChI is InChI=1S/C14H10N4/c15-11-5-12-10(7-17-18-12)13-9-4-2-1-3-8(9)6-16-14(11)13/h1-7H,15H2,(H,17,18).
What are the key properties of 3H-pyrazolo[4,5-a]phenanthridin-5-amine?
3H-pyrazolo[4,5-a]phenanthridin-5-amine has a molecular weight of 234.26 g/mol, XLogP of 2.85, 0 rotatable bonds, 2 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 3H-pyrazolo[4,5-a]phenanthridin-5-amine is sourced from PubChem (CID 118711122), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).