About 8-fluoro-3H-pyrazolo[4,5-a]phenanthridin-5-amine
8-fluoro-3H-pyrazolo[4,5-a]phenanthridin-5-amine (PubChem CID 118711125) has the molecular formula C14H9FN4
and a molecular weight of 252.25 g/mol. Its IUPAC name is 8-fluoro-3H-pyrazolo[4,5-a]phenanthridin-5-amine.
Molecular Properties
| Compound Name | 8-fluoro-3H-pyrazolo[4,5-a]phenanthridin-5-amine |
| PubChem CID | 118711125 |
| Molecular Formula | C14H9FN4 |
| Molecular Weight | 252.25 g/mol |
| Exact Mass | 252.08 |
| IUPAC Name | 8-fluoro-3H-pyrazolo[4,5-a]phenanthridin-5-amine |
| SMILES | Nc1cc2[nH]ncc2c2c1ncc1c(F)cccc12 |
| InChI | InChI=1S/C14H9FN4/c15-10-3-1-2-7-8(10)5-17-14-11(16)4-12-9(13(7)14)6-18-19-12/h1-6H,16H2,(H,18,19) |
| InChIKey | GLCZIHHDCJHBAD-UHFFFAOYSA-N |
| XLogP | 2.99 |
| TPSA | 67.59 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | |
| Heavy Atoms | 19 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 252.25 |
| LogP ≤ 5 | 2.99 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'}, {'alert_name': 'Polycyclic_aromatic_hydrocarbon_3', 'substructure': 'N/A'} |
|---|
Analyze 8-fluoro-3H-pyrazolo[4,5-a]phenanthridin-5-amine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 8-fluoro-3H-pyrazolo[4,5-a]phenanthridin-5-amine?
The IUPAC name of 8-fluoro-3H-pyrazolo[4,5-a]phenanthridin-5-amine (CID 118711125) is 8-fluoro-3H-pyrazolo[4,5-a]phenanthridin-5-amine.
What is the SMILES notation for 8-fluoro-3H-pyrazolo[4,5-a]phenanthridin-5-amine?
The canonical SMILES for 8-fluoro-3H-pyrazolo[4,5-a]phenanthridin-5-amine is Nc1cc2[nH]ncc2c2c1ncc1c(F)cccc12.
What is the InChIKey of 8-fluoro-3H-pyrazolo[4,5-a]phenanthridin-5-amine?
The InChIKey is GLCZIHHDCJHBAD-UHFFFAOYSA-N. The full InChI is InChI=1S/C14H9FN4/c15-10-3-1-2-7-8(10)5-17-14-11(16)4-12-9(13(7)14)6-18-19-12/h1-6H,16H2,(H,18,19).
What are the key properties of 8-fluoro-3H-pyrazolo[4,5-a]phenanthridin-5-amine?
8-fluoro-3H-pyrazolo[4,5-a]phenanthridin-5-amine has a molecular weight of 252.25 g/mol, XLogP of 2.99, 0 rotatable bonds, 2 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 8-fluoro-3H-pyrazolo[4,5-a]phenanthridin-5-amine is sourced from PubChem (CID 118711125), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).