C18H22N2O — CID 118711127
1-(2-ethylphenyl)-3,6,6-trimethyl-5,7-dihydroindazol-4-one (PubChem CID 118711127) has the molecular formula C18H22N2O and a molecular weight of 282.39 g/mol. Its IUPAC name is 1-(2-ethylphenyl)-3,6,6-trimethyl-5,7-dihydroindazol-4-one.
| Compound Name | 1-(2-ethylphenyl)-3,6,6-trimethyl-5,7-dihydroindazol-4-one |
|---|---|
| PubChem CID | 118711127 |
| Molecular Formula | C18H22N2O |
| Molecular Weight | 282.39 g/mol |
| Exact Mass | 282.17 |
| IUPAC Name | 1-(2-ethylphenyl)-3,6,6-trimethyl-5,7-dihydroindazol-4-one |
| SMILES | CCc1ccccc1-n1nc(C)c2c1CC(C)(C)CC2=O |
| InChI | InChI=1S/C18H22N2O/c1-5-13-8-6-7-9-14(13)20-15-10-18(3,4)11-16(21)17(15)12(2)19-20/h6-9H,5,10-11H2,1-4H3 |
| InChIKey | JIAJBINLEDNMJU-UHFFFAOYSA-N |
| XLogP | 3.90 |
| TPSA | 34.89 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 282.39 |
| LogP ≤ 5 | 3.90 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |