C21H24O6 — CID 118711164
5-[(2R,3R,4R,5S)-5-(1,3-benzodioxol-5-yl)-3,4-dimethyloxolan-2-yl]-2,3-dimethoxyphenol (PubChem CID 118711164) has the molecular formula C21H24O6 and a molecular weight of 372.42 g/mol. Its IUPAC name is 5-[(2R,3R,4R,5S)-5-(1,3-benzodioxol-5-yl)-3,4-dimethyloxolan-2-yl]-2,3-dimethoxyphenol.
| Compound Name | 5-[(2R,3R,4R,5S)-5-(1,3-benzodioxol-5-yl)-3,4-dimethyloxolan-2-yl]-2,3-dimethoxyphenol |
|---|---|
| PubChem CID | 118711164 |
| Molecular Formula | C21H24O6 |
| Molecular Weight | 372.42 g/mol |
| Exact Mass | 372.16 |
| IUPAC Name | 5-[(2R,3R,4R,5S)-5-(1,3-benzodioxol-5-yl)-3,4-dimethyloxolan-2-yl]-2,3-dimethoxyphenol |
| SMILES | COc1cc([C@@H]2O[C@H](c3ccc4c(c3)OCO4)[C@H](C)[C@H]2C)cc(O)c1OC |
| InChI | InChI=1S/C21H24O6/c1-11-12(2)20(14-7-15(22)21(24-4)18(9-14)23-3)27-19(11)13-5-6-16-17(8-13)26-10-25-16/h5-9,11-12,19-20,22H,10H2,1-4H3/t11-,12-,19+,20-/m1/s1 |
| InChIKey | RYXZHMFDFUHLJB-DRLYEABHSA-N |
| XLogP | 4.22 |
| TPSA | 66.38 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 372.42 |
| LogP ≤ 5 | 4.22 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |