C31H53N3 — CID 118711169
1-[(2Z)-3,7-dimethylocta-2,6-dienyl]-1,2-bis[(2E)-3,7-dimethylocta-2,6-dienyl]guanidine (PubChem CID 118711169) has the molecular formula C31H53N3 and a molecular weight of 467.79 g/mol. Its IUPAC name is 1-[(2Z)-3,7-dimethylocta-2,6-dienyl]-1,2-bis[(2E)-3,7-dimethylocta-2,6-dienyl]guanidine.
| Compound Name | 1-[(2Z)-3,7-dimethylocta-2,6-dienyl]-1,2-bis[(2E)-3,7-dimethylocta-2,6-dienyl]guanidine |
|---|---|
| PubChem CID | 118711169 |
| Molecular Formula | C31H53N3 |
| Molecular Weight | 467.79 g/mol |
| Exact Mass | 467.42 |
| IUPAC Name | 1-[(2Z)-3,7-dimethylocta-2,6-dienyl]-1,2-bis[(2E)-3,7-dimethylocta-2,6-dienyl]guanidine |
| SMILES | CC(C)=CCC/C(C)=C\CN(C/C=C(\C)CCC=C(C)C)/C(N)=N/C/C=C(\C)CCC=C(C)C |
| InChI | InChI=1S/C31H53N3/c1-25(2)13-10-16-28(7)19-22-33-31(32)34(23-20-29(8)17-11-14-26(3)4)24-21-30(9)18-12-15-27(5)6/h13-15,19-21H,10-12,16-18,22-24H2,1-9H3,(H2,32,33)/b28-19+,29-20-,30-21+ |
| InChIKey | YTTUNPLJOUETEY-SIOANQDOSA-N |
| XLogP | 8.68 |
| TPSA | 41.62 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 15 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 467.79 |
| LogP ≤ 5 | 8.68 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|