C25H28N2O — CID 118711258
3-methyl-8-[(4-methylphenyl)methylamino]-5-phenyl-1,2,4,5-tetrahydro-3-benzazepin-7-ol (PubChem CID 118711258) has the molecular formula C25H28N2O and a molecular weight of 372.51 g/mol. Its IUPAC name is 3-methyl-8-[(4-methylphenyl)methylamino]-5-phenyl-1,2,4,5-tetrahydro-3-benzazepin-7-ol.
| Compound Name | 3-methyl-8-[(4-methylphenyl)methylamino]-5-phenyl-1,2,4,5-tetrahydro-3-benzazepin-7-ol |
|---|---|
| PubChem CID | 118711258 |
| Molecular Formula | C25H28N2O |
| Molecular Weight | 372.51 g/mol |
| Exact Mass | 372.22 |
| IUPAC Name | 3-methyl-8-[(4-methylphenyl)methylamino]-5-phenyl-1,2,4,5-tetrahydro-3-benzazepin-7-ol |
| SMILES | Cc1ccc(CNc2cc3c(cc2O)C(c2ccccc2)CN(C)CC3)cc1 |
| InChI | InChI=1S/C25H28N2O/c1-18-8-10-19(11-9-18)16-26-24-14-21-12-13-27(2)17-23(22(21)15-25(24)28)20-6-4-3-5-7-20/h3-11,14-15,23,26,28H,12-13,16-17H2,1-2H3 |
| InChIKey | RYHACVCHCMPULY-UHFFFAOYSA-N |
| XLogP | 4.93 |
| TPSA | 35.50 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 372.51 |
| LogP ≤ 5 | 4.93 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'catechol', 'substructure': 'N/A'} |
|---|