C18H22N2 — CID 118711269
N,3-dimethyl-5-phenyl-1,2,4,5-tetrahydro-3-benzazepin-7-amine (PubChem CID 118711269) has the molecular formula C18H22N2 and a molecular weight of 266.39 g/mol. Its IUPAC name is N,3-dimethyl-5-phenyl-1,2,4,5-tetrahydro-3-benzazepin-7-amine.
| Compound Name | N,3-dimethyl-5-phenyl-1,2,4,5-tetrahydro-3-benzazepin-7-amine |
|---|---|
| PubChem CID | 118711269 |
| Molecular Formula | C18H22N2 |
| Molecular Weight | 266.39 g/mol |
| Exact Mass | 266.18 |
| IUPAC Name | N,3-dimethyl-5-phenyl-1,2,4,5-tetrahydro-3-benzazepin-7-amine |
| SMILES | CNc1ccc2c(c1)C(c1ccccc1)CN(C)CC2 |
| InChI | InChI=1S/C18H22N2/c1-19-16-9-8-15-10-11-20(2)13-18(17(15)12-16)14-6-4-3-5-7-14/h3-9,12,18-19H,10-11,13H2,1-2H3 |
| InChIKey | CUSZCLNHUVAVNP-UHFFFAOYSA-N |
| XLogP | 3.35 |
| TPSA | 15.27 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 266.39 |
| LogP ≤ 5 | 3.35 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |