About methyl 2-[(3R,4S,6S)-4-ethyl-6-[(2S)-2-ethyl-4-methyloctyl]-6-methyldioxan-3-yl]acetate
methyl 2-[(3R,4S,6S)-4-ethyl-6-[(2S)-2-ethyl-4-methyloctyl]-6-methyldioxan-3-yl]acetate (PubChem CID 118711423) has the molecular formula C21H40O4
and a molecular weight of 356.55 g/mol. Its IUPAC name is methyl 2-[(3R,4S,6S)-4-ethyl-6-[(2S)-2-ethyl-4-methyloctyl]-6-methyldioxan-3-yl]acetate.
Molecular Properties
| Compound Name | methyl 2-[(3R,4S,6S)-4-ethyl-6-[(2S)-2-ethyl-4-methyloctyl]-6-methyldioxan-3-yl]acetate |
| PubChem CID | 118711423 |
| Molecular Formula | C21H40O4 |
| Molecular Weight | 356.55 g/mol |
| Exact Mass | 356.29 |
| IUPAC Name | methyl 2-[(3R,4S,6S)-4-ethyl-6-[(2S)-2-ethyl-4-methyloctyl]-6-methyldioxan-3-yl]acetate |
| SMILES | CCCCC(C)C[C@H](CC)C[C@@]1(C)C[C@H](CC)[C@@H](CC(=O)OC)OO1 |
| InChI | InChI=1S/C21H40O4/c1-7-10-11-16(4)12-17(8-2)14-21(5)15-18(9-3)19(24-25-21)13-20(22)23-6/h16-19H,7-15H2,1-6H3/t16?,17-,18-,19+,21-/m0/s1 |
| InChIKey | PVDHZAKYWJYCOD-ISHSYCIMSA-N |
| XLogP | 5.69 |
| TPSA | 44.76 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 25 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 356.55 |
| LogP ≤ 5 | 5.69 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'peroxide', 'substructure': 'N/A'} |
|---|
Analyze methyl 2-[(3R,4S,6S)-4-ethyl-6-[(2S)-2-ethyl-4-methyloctyl]-6-methyldioxan-3-yl]acetate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of methyl 2-[(3R,4S,6S)-4-ethyl-6-[(2S)-2-ethyl-4-methyloctyl]-6-methyldioxan-3-yl]acetate?
The IUPAC name of methyl 2-[(3R,4S,6S)-4-ethyl-6-[(2S)-2-ethyl-4-methyloctyl]-6-methyldioxan-3-yl]acetate (CID 118711423) is methyl 2-[(3R,4S,6S)-4-ethyl-6-[(2S)-2-ethyl-4-methyloctyl]-6-methyldioxan-3-yl]acetate.
What is the SMILES notation for methyl 2-[(3R,4S,6S)-4-ethyl-6-[(2S)-2-ethyl-4-methyloctyl]-6-methyldioxan-3-yl]acetate?
The canonical SMILES for methyl 2-[(3R,4S,6S)-4-ethyl-6-[(2S)-2-ethyl-4-methyloctyl]-6-methyldioxan-3-yl]acetate is CCCCC(C)C[C@H](CC)C[C@@]1(C)C[C@H](CC)[C@@H](CC(=O)OC)OO1.
What is the InChIKey of methyl 2-[(3R,4S,6S)-4-ethyl-6-[(2S)-2-ethyl-4-methyloctyl]-6-methyldioxan-3-yl]acetate?
The InChIKey is PVDHZAKYWJYCOD-ISHSYCIMSA-N. The full InChI is InChI=1S/C21H40O4/c1-7-10-11-16(4)12-17(8-2)14-21(5)15-18(9-3)19(24-25-21)13-20(22)23-6/h16-19H,7-15H2,1-6H3/t16?,17-,18-,19+,21-/m0/s1.
What are the key properties of methyl 2-[(3R,4S,6S)-4-ethyl-6-[(2S)-2-ethyl-4-methyloctyl]-6-methyldioxan-3-yl]acetate?
methyl 2-[(3R,4S,6S)-4-ethyl-6-[(2S)-2-ethyl-4-methyloctyl]-6-methyldioxan-3-yl]acetate has a molecular weight of 356.55 g/mol, XLogP of 5.69, 11 rotatable bonds, 0 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for methyl 2-[(3R,4S,6S)-4-ethyl-6-[(2S)-2-ethyl-4-methyloctyl]-6-methyldioxan-3-yl]acetate is sourced from PubChem (CID 118711423), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).