About 2-methylsulfinylethyl (2S)-2-(6-methoxynaphthalen-2-yl)propanoate
2-methylsulfinylethyl (2S)-2-(6-methoxynaphthalen-2-yl)propanoate (PubChem CID 118711604) has the molecular formula C17H20O4S
and a molecular weight of 320.41 g/mol. Its IUPAC name is 2-methylsulfinylethyl (2S)-2-(6-methoxynaphthalen-2-yl)propanoate.
Molecular Properties
| Compound Name | 2-methylsulfinylethyl (2S)-2-(6-methoxynaphthalen-2-yl)propanoate |
| PubChem CID | 118711604 |
| Molecular Formula | C17H20O4S |
| Molecular Weight | 320.41 g/mol |
| Exact Mass | 320.11 |
| IUPAC Name | 2-methylsulfinylethyl (2S)-2-(6-methoxynaphthalen-2-yl)propanoate |
| SMILES | COc1ccc2cc([C@H](C)C(=O)OCCS(C)=O)ccc2c1 |
| InChI | InChI=1S/C17H20O4S/c1-12(17(18)21-8-9-22(3)19)13-4-5-15-11-16(20-2)7-6-14(15)10-13/h4-7,10-12H,8-9H2,1-3H3/t12-,22?/m0/s1 |
| InChIKey | TYPFNGYHRVKGRO-BJDAYTSDSA-N |
| XLogP | 2.87 |
| TPSA | 52.60 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 22 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 320.41 |
| LogP ≤ 5 | 2.87 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze 2-methylsulfinylethyl (2S)-2-(6-methoxynaphthalen-2-yl)propanoate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-methylsulfinylethyl (2S)-2-(6-methoxynaphthalen-2-yl)propanoate?
The IUPAC name of 2-methylsulfinylethyl (2S)-2-(6-methoxynaphthalen-2-yl)propanoate (CID 118711604) is 2-methylsulfinylethyl (2S)-2-(6-methoxynaphthalen-2-yl)propanoate.
What is the SMILES notation for 2-methylsulfinylethyl (2S)-2-(6-methoxynaphthalen-2-yl)propanoate?
The canonical SMILES for 2-methylsulfinylethyl (2S)-2-(6-methoxynaphthalen-2-yl)propanoate is COc1ccc2cc([C@H](C)C(=O)OCCS(C)=O)ccc2c1.
What is the InChIKey of 2-methylsulfinylethyl (2S)-2-(6-methoxynaphthalen-2-yl)propanoate?
The InChIKey is TYPFNGYHRVKGRO-BJDAYTSDSA-N. The full InChI is InChI=1S/C17H20O4S/c1-12(17(18)21-8-9-22(3)19)13-4-5-15-11-16(20-2)7-6-14(15)10-13/h4-7,10-12H,8-9H2,1-3H3/t12-,22?/m0/s1.
What are the key properties of 2-methylsulfinylethyl (2S)-2-(6-methoxynaphthalen-2-yl)propanoate?
2-methylsulfinylethyl (2S)-2-(6-methoxynaphthalen-2-yl)propanoate has a molecular weight of 320.41 g/mol, XLogP of 2.87, 6 rotatable bonds, 0 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 2-methylsulfinylethyl (2S)-2-(6-methoxynaphthalen-2-yl)propanoate is sourced from PubChem (CID 118711604), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).