C10H7BrF4N4O2S — CID 118711622
4-[4-(2-bromoethyl)triazol-1-yl]-2,3,5,6-tetrafluorobenzenesulfonamide (PubChem CID 118711622) has the molecular formula C10H7BrF4N4O2S and a molecular weight of 403.16 g/mol. Its IUPAC name is 4-[4-(2-bromoethyl)triazol-1-yl]-2,3,5,6-tetrafluorobenzenesulfonamide.
| Compound Name | 4-[4-(2-bromoethyl)triazol-1-yl]-2,3,5,6-tetrafluorobenzenesulfonamide |
|---|---|
| PubChem CID | 118711622 |
| Molecular Formula | C10H7BrF4N4O2S |
| Molecular Weight | 403.16 g/mol |
| Exact Mass | 401.94 |
| IUPAC Name | 4-[4-(2-bromoethyl)triazol-1-yl]-2,3,5,6-tetrafluorobenzenesulfonamide |
| SMILES | NS(=O)(=O)c1c(F)c(F)c(-n2cc(CCBr)nn2)c(F)c1F |
| InChI | InChI=1S/C10H7BrF4N4O2S/c11-2-1-4-3-19(18-17-4)9-5(12)7(14)10(22(16,20)21)8(15)6(9)13/h3H,1-2H2,(H2,16,20,21) |
| InChIKey | JMWBFQICPMCBHK-UHFFFAOYSA-N |
| XLogP | 1.41 |
| TPSA | 90.87 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 403.16 |
| LogP ≤ 5 | 1.41 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'} |
|---|