C11H9ClF4N4O2S — CID 118711623
4-[4-(3-chloropropyl)triazol-1-yl]-2,3,5,6-tetrafluorobenzenesulfonamide (PubChem CID 118711623) has the molecular formula C11H9ClF4N4O2S and a molecular weight of 372.73 g/mol. Its IUPAC name is 4-[4-(3-chloropropyl)triazol-1-yl]-2,3,5,6-tetrafluorobenzenesulfonamide.
| Compound Name | 4-[4-(3-chloropropyl)triazol-1-yl]-2,3,5,6-tetrafluorobenzenesulfonamide |
|---|---|
| PubChem CID | 118711623 |
| Molecular Formula | C11H9ClF4N4O2S |
| Molecular Weight | 372.73 g/mol |
| Exact Mass | 372.01 |
| IUPAC Name | 4-[4-(3-chloropropyl)triazol-1-yl]-2,3,5,6-tetrafluorobenzenesulfonamide |
| SMILES | NS(=O)(=O)c1c(F)c(F)c(-n2cc(CCCCl)nn2)c(F)c1F |
| InChI | InChI=1S/C11H9ClF4N4O2S/c12-3-1-2-5-4-20(19-18-5)10-6(13)8(15)11(23(17,21)22)9(16)7(10)14/h4H,1-3H2,(H2,17,21,22) |
| InChIKey | IZFJYEAIMMNRBL-UHFFFAOYSA-N |
| XLogP | 1.64 |
| TPSA | 90.87 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 372.73 |
| LogP ≤ 5 | 1.64 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'} |
|---|