C12H11ClF4N4O2S — CID 118711624
4-[4-(4-chlorobutyl)triazol-1-yl]-2,3,5,6-tetrafluorobenzenesulfonamide (PubChem CID 118711624) has the molecular formula C12H11ClF4N4O2S and a molecular weight of 386.76 g/mol. Its IUPAC name is 4-[4-(4-chlorobutyl)triazol-1-yl]-2,3,5,6-tetrafluorobenzenesulfonamide.
| Compound Name | 4-[4-(4-chlorobutyl)triazol-1-yl]-2,3,5,6-tetrafluorobenzenesulfonamide |
|---|---|
| PubChem CID | 118711624 |
| Molecular Formula | C12H11ClF4N4O2S |
| Molecular Weight | 386.76 g/mol |
| Exact Mass | 386.02 |
| IUPAC Name | 4-[4-(4-chlorobutyl)triazol-1-yl]-2,3,5,6-tetrafluorobenzenesulfonamide |
| SMILES | NS(=O)(=O)c1c(F)c(F)c(-n2cc(CCCCCl)nn2)c(F)c1F |
| InChI | InChI=1S/C12H11ClF4N4O2S/c13-4-2-1-3-6-5-21(20-19-6)11-7(14)9(16)12(24(18,22)23)10(17)8(11)15/h5H,1-4H2,(H2,18,22,23) |
| InChIKey | OKGJHKFCKBDZDS-UHFFFAOYSA-N |
| XLogP | 2.03 |
| TPSA | 90.87 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 386.76 |
| LogP ≤ 5 | 2.03 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'} |
|---|