C9H6F4N4O3S — CID 118711625
2,3,5,6-tetrafluoro-4-[4-(hydroxymethyl)triazol-1-yl]benzenesulfonamide (PubChem CID 118711625) has the molecular formula C9H6F4N4O3S and a molecular weight of 326.23 g/mol. Its IUPAC name is 2,3,5,6-tetrafluoro-4-[4-(hydroxymethyl)triazol-1-yl]benzenesulfonamide.
| Compound Name | 2,3,5,6-tetrafluoro-4-[4-(hydroxymethyl)triazol-1-yl]benzenesulfonamide |
|---|---|
| PubChem CID | 118711625 |
| Molecular Formula | C9H6F4N4O3S |
| Molecular Weight | 326.23 g/mol |
| Exact Mass | 326.01 |
| IUPAC Name | 2,3,5,6-tetrafluoro-4-[4-(hydroxymethyl)triazol-1-yl]benzenesulfonamide |
| SMILES | NS(=O)(=O)c1c(F)c(F)c(-n2cc(CO)nn2)c(F)c1F |
| InChI | InChI=1S/C9H6F4N4O3S/c10-4-6(12)9(21(14,19)20)7(13)5(11)8(4)17-1-3(2-18)15-16-17/h1,18H,2H2,(H2,14,19,20) |
| InChIKey | GXJJZIMHFQIMHB-UHFFFAOYSA-N |
| XLogP | -0.04 |
| TPSA | 111.10 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 326.23 |
| LogP ≤ 5 | -0.04 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'} |
|---|