C14H15F4N5O4S — CID 118711626
tert-butyl N-[[1-(2,3,5,6-tetrafluoro-4-sulfamoylphenyl)triazol-4-yl]methyl]carbamate (PubChem CID 118711626) has the molecular formula C14H15F4N5O4S and a molecular weight of 425.36 g/mol. Its IUPAC name is tert-butyl N-[[1-(2,3,5,6-tetrafluoro-4-sulfamoylphenyl)triazol-4-yl]methyl]carbamate.
| Compound Name | tert-butyl N-[[1-(2,3,5,6-tetrafluoro-4-sulfamoylphenyl)triazol-4-yl]methyl]carbamate |
|---|---|
| PubChem CID | 118711626 |
| Molecular Formula | C14H15F4N5O4S |
| Molecular Weight | 425.36 g/mol |
| Exact Mass | 425.08 |
| IUPAC Name | tert-butyl N-[[1-(2,3,5,6-tetrafluoro-4-sulfamoylphenyl)triazol-4-yl]methyl]carbamate |
| SMILES | CC(C)(C)OC(=O)NCc1cn(-c2c(F)c(F)c(S(N)(=O)=O)c(F)c2F)nn1 |
| InChI | InChI=1S/C14H15F4N5O4S/c1-14(2,3)27-13(24)20-4-6-5-23(22-21-6)11-7(15)9(17)12(28(19,25)26)10(18)8(11)16/h5H,4H2,1-3H3,(H,20,24)(H2,19,25,26) |
| InChIKey | JNDHGMUYOOCXJU-UHFFFAOYSA-N |
| XLogP | 1.50 |
| TPSA | 129.20 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 425.36 |
| LogP ≤ 5 | 1.50 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'} |
|---|