C20H19Cl2N5O3 — CID 118711634
N-[2-(cyanomethylamino)-2-oxoethyl]-2-[[2-(3,5-dichlorophenyl)acetyl]amino]-3-pyridin-2-ylpropanamide (PubChem CID 118711634) has the molecular formula C20H19Cl2N5O3 and a molecular weight of 448.31 g/mol. Its IUPAC name is N-[2-(cyanomethylamino)-2-oxoethyl]-2-[[2-(3,5-dichlorophenyl)acetyl]amino]-3-pyridin-2-ylpropanamide.
| Compound Name | N-[2-(cyanomethylamino)-2-oxoethyl]-2-[[2-(3,5-dichlorophenyl)acetyl]amino]-3-pyridin-2-ylpropanamide |
|---|---|
| PubChem CID | 118711634 |
| Molecular Formula | C20H19Cl2N5O3 |
| Molecular Weight | 448.31 g/mol |
| Exact Mass | 447.09 |
| IUPAC Name | N-[2-(cyanomethylamino)-2-oxoethyl]-2-[[2-(3,5-dichlorophenyl)acetyl]amino]-3-pyridin-2-ylpropanamide |
| SMILES | N#CCNC(=O)CNC(=O)C(Cc1ccccn1)NC(=O)Cc1cc(Cl)cc(Cl)c1 |
| InChI | InChI=1S/C20H19Cl2N5O3/c21-14-7-13(8-15(22)10-14)9-18(28)27-17(11-16-3-1-2-5-24-16)20(30)26-12-19(29)25-6-4-23/h1-3,5,7-8,10,17H,6,9,11-12H2,(H,25,29)(H,26,30)(H,27,28) |
| InChIKey | BZTAVLPRISYGFX-UHFFFAOYSA-N |
| XLogP | 1.41 |
| TPSA | 123.98 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 448.31 |
| LogP ≤ 5 | 1.41 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'cyanamide', 'substructure': 'N/A'} |
|---|