About 8-fluoro-5-nitro-3H-pyrazolo[4,3-a]phenanthridine
8-fluoro-5-nitro-3H-pyrazolo[4,3-a]phenanthridine (PubChem CID 118711718) has the molecular formula C14H7FN4O2
and a molecular weight of 282.23 g/mol. Its IUPAC name is 8-fluoro-5-nitro-3H-pyrazolo[4,3-a]phenanthridine.
Molecular Properties
| Compound Name | 8-fluoro-5-nitro-3H-pyrazolo[4,3-a]phenanthridine |
| PubChem CID | 118711718 |
| Molecular Formula | C14H7FN4O2 |
| Molecular Weight | 282.23 g/mol |
| Exact Mass | 282.06 |
| IUPAC Name | 8-fluoro-5-nitro-3H-pyrazolo[4,3-a]phenanthridine |
| SMILES | O=[N+]([O-])c1cc2[nH]ncc2c2c1ncc1c(F)cccc12 |
| InChI | InChI=1S/C14H7FN4O2/c15-10-3-1-2-7-8(10)5-16-14-12(19(20)21)4-11-9(13(7)14)6-17-18-11/h1-6H,(H,17,18) |
| InChIKey | XKUZHDHUOAPVLO-UHFFFAOYSA-N |
| XLogP | 3.31 |
| TPSA | 84.71 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 21 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 282.23 |
| LogP ≤ 5 | 3.31 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'Polycyclic_aromatic_hydrocarbon_3', 'substructure': 'N/A'} |
|---|
Analyze 8-fluoro-5-nitro-3H-pyrazolo[4,3-a]phenanthridine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 8-fluoro-5-nitro-3H-pyrazolo[4,3-a]phenanthridine?
The IUPAC name of 8-fluoro-5-nitro-3H-pyrazolo[4,3-a]phenanthridine (CID 118711718) is 8-fluoro-5-nitro-3H-pyrazolo[4,3-a]phenanthridine.
What is the SMILES notation for 8-fluoro-5-nitro-3H-pyrazolo[4,3-a]phenanthridine?
The canonical SMILES for 8-fluoro-5-nitro-3H-pyrazolo[4,3-a]phenanthridine is O=[N+]([O-])c1cc2[nH]ncc2c2c1ncc1c(F)cccc12.
What is the InChIKey of 8-fluoro-5-nitro-3H-pyrazolo[4,3-a]phenanthridine?
The InChIKey is XKUZHDHUOAPVLO-UHFFFAOYSA-N. The full InChI is InChI=1S/C14H7FN4O2/c15-10-3-1-2-7-8(10)5-16-14-12(19(20)21)4-11-9(13(7)14)6-17-18-11/h1-6H,(H,17,18).
What are the key properties of 8-fluoro-5-nitro-3H-pyrazolo[4,3-a]phenanthridine?
8-fluoro-5-nitro-3H-pyrazolo[4,3-a]phenanthridine has a molecular weight of 282.23 g/mol, XLogP of 3.31, 1 rotatable bonds, 1 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 8-fluoro-5-nitro-3H-pyrazolo[4,3-a]phenanthridine is sourced from PubChem (CID 118711718), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).