C15H8N4O4 — CID 118711719
9-nitro-16,18-dioxa-5,6,11-triazapentacyclo[11.7.0.02,10.03,7.015,19]icosa-1(20),2,4,7,9,11,13,15(19)-octaene (PubChem CID 118711719) has the molecular formula C15H8N4O4 and a molecular weight of 308.25 g/mol. Its IUPAC name is 9-nitro-16,18-dioxa-5,6,11-triazapentacyclo[11.7.0.02,10.03,7.015,19]icosa-1(20),2,4,7,9,11,13,15(19)-octaene.
| Compound Name | 9-nitro-16,18-dioxa-5,6,11-triazapentacyclo[11.7.0.02,10.03,7.015,19]icosa-1(20),2,4,7,9,11,13,15(19)-octaene |
|---|---|
| PubChem CID | 118711719 |
| Molecular Formula | C15H8N4O4 |
| Molecular Weight | 308.25 g/mol |
| Exact Mass | 308.05 |
| IUPAC Name | 9-nitro-16,18-dioxa-5,6,11-triazapentacyclo[11.7.0.02,10.03,7.015,19]icosa-1(20),2,4,7,9,11,13,15(19)-octaene |
| SMILES | O=[N+]([O-])c1cc2[nH]ncc2c2c1ncc1cc3c(cc12)OCO3 |
| InChI | InChI=1S/C15H8N4O4/c20-19(21)11-3-10-9(5-17-18-10)14-8-2-13-12(22-6-23-13)1-7(8)4-16-15(11)14/h1-5H,6H2,(H,17,18) |
| InChIKey | YBPHBMYSPLWDCC-UHFFFAOYSA-N |
| XLogP | 2.90 |
| TPSA | 103.17 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 308.25 |
| LogP ≤ 5 | 2.90 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'Polycyclic_aromatic_hydrocarbon_3', 'substructure': 'N/A'} |
|---|