C15H20O4 — CID 118711727
2-[(3R,5R,8S)-3-hydroxy-3,8-dimethyl-1-oxo-2,4,5,6,7,8-hexahydroazulen-5-yl]prop-2-enoic acid (PubChem CID 118711727) has the molecular formula C15H20O4 and a molecular weight of 264.32 g/mol. Its IUPAC name is 2-[(3R,5R,8S)-3-hydroxy-3,8-dimethyl-1-oxo-2,4,5,6,7,8-hexahydroazulen-5-yl]prop-2-enoic acid.
| Compound Name | 2-[(3R,5R,8S)-3-hydroxy-3,8-dimethyl-1-oxo-2,4,5,6,7,8-hexahydroazulen-5-yl]prop-2-enoic acid |
|---|---|
| PubChem CID | 118711727 |
| Molecular Formula | C15H20O4 |
| Molecular Weight | 264.32 g/mol |
| Exact Mass | 264.14 |
| IUPAC Name | 2-[(3R,5R,8S)-3-hydroxy-3,8-dimethyl-1-oxo-2,4,5,6,7,8-hexahydroazulen-5-yl]prop-2-enoic acid |
| SMILES | C=C(C(=O)O)[C@@H]1CC[C@H](C)C2=C(C1)[C@](C)(O)CC2=O |
| InChI | InChI=1S/C15H20O4/c1-8-4-5-10(9(2)14(17)18)6-11-13(8)12(16)7-15(11,3)19/h8,10,19H,2,4-7H2,1,3H3,(H,17,18)/t8-,10+,15+/m0/s1 |
| InChIKey | CNDFIUCLMNGTNC-SVIKCVJRSA-N |
| XLogP | 2.08 |
| TPSA | 74.60 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 264.32 |
| LogP ≤ 5 | 2.08 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|