About 4-decyl-6-(dimethylamino)-2,5-dimethylpyridin-3-ol
4-decyl-6-(dimethylamino)-2,5-dimethylpyridin-3-ol (PubChem CID 118711804) has the molecular formula C19H34N2O
and a molecular weight of 306.49 g/mol. Its IUPAC name is 4-decyl-6-(dimethylamino)-2,5-dimethylpyridin-3-ol.
Molecular Properties
| Compound Name | 4-decyl-6-(dimethylamino)-2,5-dimethylpyridin-3-ol |
| PubChem CID | 118711804 |
| Molecular Formula | C19H34N2O |
| Molecular Weight | 306.49 g/mol |
| Exact Mass | 306.27 |
| IUPAC Name | 4-decyl-6-(dimethylamino)-2,5-dimethylpyridin-3-ol |
| SMILES | CCCCCCCCCCc1c(C)c(N(C)C)nc(C)c1O |
| InChI | InChI=1S/C19H34N2O/c1-6-7-8-9-10-11-12-13-14-17-15(2)19(21(4)5)20-16(3)18(17)22/h22H,6-14H2,1-5H3 |
| InChIKey | SOGXHONSGULDFB-UHFFFAOYSA-N |
| XLogP | 5.15 |
| TPSA | 36.36 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 22 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 306.49 |
| LogP ≤ 5 | 5.15 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|
Analyze 4-decyl-6-(dimethylamino)-2,5-dimethylpyridin-3-ol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4-decyl-6-(dimethylamino)-2,5-dimethylpyridin-3-ol?
The IUPAC name of 4-decyl-6-(dimethylamino)-2,5-dimethylpyridin-3-ol (CID 118711804) is 4-decyl-6-(dimethylamino)-2,5-dimethylpyridin-3-ol.
What is the SMILES notation for 4-decyl-6-(dimethylamino)-2,5-dimethylpyridin-3-ol?
The canonical SMILES for 4-decyl-6-(dimethylamino)-2,5-dimethylpyridin-3-ol is CCCCCCCCCCc1c(C)c(N(C)C)nc(C)c1O.
What is the InChIKey of 4-decyl-6-(dimethylamino)-2,5-dimethylpyridin-3-ol?
The InChIKey is SOGXHONSGULDFB-UHFFFAOYSA-N. The full InChI is InChI=1S/C19H34N2O/c1-6-7-8-9-10-11-12-13-14-17-15(2)19(21(4)5)20-16(3)18(17)22/h22H,6-14H2,1-5H3.
What are the key properties of 4-decyl-6-(dimethylamino)-2,5-dimethylpyridin-3-ol?
4-decyl-6-(dimethylamino)-2,5-dimethylpyridin-3-ol has a molecular weight of 306.49 g/mol, XLogP of 5.15, 10 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 4-decyl-6-(dimethylamino)-2,5-dimethylpyridin-3-ol is sourced from PubChem (CID 118711804), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).