C11H8BrN5 — CID 118711841
6-bromo-N-pyridin-4-ylpyrrolo[2,1-f][1,2,4]triazin-4-amine (PubChem CID 118711841) has the molecular formula C11H8BrN5 and a molecular weight of 290.12 g/mol. Its IUPAC name is 6-bromo-N-pyridin-4-ylpyrrolo[2,1-f][1,2,4]triazin-4-amine.
| Compound Name | 6-bromo-N-pyridin-4-ylpyrrolo[2,1-f][1,2,4]triazin-4-amine |
|---|---|
| PubChem CID | 118711841 |
| Molecular Formula | C11H8BrN5 |
| Molecular Weight | 290.12 g/mol |
| Exact Mass | 289.00 |
| IUPAC Name | 6-bromo-N-pyridin-4-ylpyrrolo[2,1-f][1,2,4]triazin-4-amine |
| SMILES | Brc1cc2c(Nc3ccncc3)ncnn2c1 |
| InChI | InChI=1S/C11H8BrN5/c12-8-5-10-11(14-7-15-17(10)6-8)16-9-1-3-13-4-2-9/h1-7H,(H,13,14,15,16) |
| InChIKey | RBZZCNGZQAMXTN-UHFFFAOYSA-N |
| XLogP | 2.63 |
| TPSA | 55.11 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 290.12 |
| LogP ≤ 5 | 2.63 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |