About [3-(2,5-dimethylphenoxy)-4-oxochromen-7-yl] cyclohexanecarboxylate
[3-(2,5-dimethylphenoxy)-4-oxochromen-7-yl] cyclohexanecarboxylate (PubChem CID 1187119) has the molecular formula C24H24O5
and a molecular weight of 392.45 g/mol. Its IUPAC name is [3-(2,5-dimethylphenoxy)-4-oxochromen-7-yl] cyclohexanecarboxylate.
Molecular Properties
| Compound Name | [3-(2,5-dimethylphenoxy)-4-oxochromen-7-yl] cyclohexanecarboxylate |
| PubChem CID | 1187119 |
| Molecular Formula | C24H24O5 |
| Molecular Weight | 392.45 g/mol |
| Exact Mass | 392.16 |
| IUPAC Name | [3-(2,5-dimethylphenoxy)-4-oxochromen-7-yl] cyclohexanecarboxylate |
| SMILES | Cc1ccc(C)c(Oc2coc3cc(OC(=O)C4CCCCC4)ccc3c2=O)c1 |
| InChI | InChI=1S/C24H24O5/c1-15-8-9-16(2)20(12-15)29-22-14-27-21-13-18(10-11-19(21)23(22)25)28-24(26)17-6-4-3-5-7-17/h8-14,17H,3-7H2,1-2H3 |
| InChIKey | UGNYMBRTKIXNSB-UHFFFAOYSA-N |
| XLogP | 5.69 |
| TPSA | 65.74 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 29 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 392.45 |
| LogP ≤ 5 | 5.69 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|
Analyze [3-(2,5-dimethylphenoxy)-4-oxochromen-7-yl] cyclohexanecarboxylate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of [3-(2,5-dimethylphenoxy)-4-oxochromen-7-yl] cyclohexanecarboxylate?
The IUPAC name of [3-(2,5-dimethylphenoxy)-4-oxochromen-7-yl] cyclohexanecarboxylate (CID 1187119) is [3-(2,5-dimethylphenoxy)-4-oxochromen-7-yl] cyclohexanecarboxylate.
What is the SMILES notation for [3-(2,5-dimethylphenoxy)-4-oxochromen-7-yl] cyclohexanecarboxylate?
The canonical SMILES for [3-(2,5-dimethylphenoxy)-4-oxochromen-7-yl] cyclohexanecarboxylate is Cc1ccc(C)c(Oc2coc3cc(OC(=O)C4CCCCC4)ccc3c2=O)c1.
What is the InChIKey of [3-(2,5-dimethylphenoxy)-4-oxochromen-7-yl] cyclohexanecarboxylate?
The InChIKey is UGNYMBRTKIXNSB-UHFFFAOYSA-N. The full InChI is InChI=1S/C24H24O5/c1-15-8-9-16(2)20(12-15)29-22-14-27-21-13-18(10-11-19(21)23(22)25)28-24(26)17-6-4-3-5-7-17/h8-14,17H,3-7H2,1-2H3.
What are the key properties of [3-(2,5-dimethylphenoxy)-4-oxochromen-7-yl] cyclohexanecarboxylate?
[3-(2,5-dimethylphenoxy)-4-oxochromen-7-yl] cyclohexanecarboxylate has a molecular weight of 392.45 g/mol, XLogP of 5.69, 4 rotatable bonds, 0 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for [3-(2,5-dimethylphenoxy)-4-oxochromen-7-yl] cyclohexanecarboxylate is sourced from PubChem (CID 1187119), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).