About 2-[(2-amino-4-methyl-1,3-thiazol-5-yl)sulfanyl]-3-(4-chlorophenyl)-6-methylquinazolin-4-one
2-[(2-amino-4-methyl-1,3-thiazol-5-yl)sulfanyl]-3-(4-chlorophenyl)-6-methylquinazolin-4-one (PubChem CID 118711923) has the molecular formula C19H15ClN4OS2
and a molecular weight of 414.94 g/mol. Its IUPAC name is 2-[(2-amino-4-methyl-1,3-thiazol-5-yl)sulfanyl]-3-(4-chlorophenyl)-6-methylquinazolin-4-one.
Molecular Properties
| Compound Name | 2-[(2-amino-4-methyl-1,3-thiazol-5-yl)sulfanyl]-3-(4-chlorophenyl)-6-methylquinazolin-4-one |
| PubChem CID | 118711923 |
| Molecular Formula | C19H15ClN4OS2 |
| Molecular Weight | 414.94 g/mol |
| Exact Mass | 414.04 |
| IUPAC Name | 2-[(2-amino-4-methyl-1,3-thiazol-5-yl)sulfanyl]-3-(4-chlorophenyl)-6-methylquinazolin-4-one |
| SMILES | Cc1ccc2nc(Sc3sc(N)nc3C)n(-c3ccc(Cl)cc3)c(=O)c2c1 |
| InChI | InChI=1S/C19H15ClN4OS2/c1-10-3-8-15-14(9-10)16(25)24(13-6-4-12(20)5-7-13)19(23-15)27-17-11(2)22-18(21)26-17/h3-9H,1-2H3,(H2,21,22) |
| InChIKey | PHYUFIRNNLULLS-UHFFFAOYSA-N |
| XLogP | 4.85 |
| TPSA | 73.80 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 27 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 414.94 |
| LogP ≤ 5 | 4.85 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
Analyze 2-[(2-amino-4-methyl-1,3-thiazol-5-yl)sulfanyl]-3-(4-chlorophenyl)-6-methylquinazolin-4-one with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-[(2-amino-4-methyl-1,3-thiazol-5-yl)sulfanyl]-3-(4-chlorophenyl)-6-methylquinazolin-4-one?
The IUPAC name of 2-[(2-amino-4-methyl-1,3-thiazol-5-yl)sulfanyl]-3-(4-chlorophenyl)-6-methylquinazolin-4-one (CID 118711923) is 2-[(2-amino-4-methyl-1,3-thiazol-5-yl)sulfanyl]-3-(4-chlorophenyl)-6-methylquinazolin-4-one.
What is the SMILES notation for 2-[(2-amino-4-methyl-1,3-thiazol-5-yl)sulfanyl]-3-(4-chlorophenyl)-6-methylquinazolin-4-one?
The canonical SMILES for 2-[(2-amino-4-methyl-1,3-thiazol-5-yl)sulfanyl]-3-(4-chlorophenyl)-6-methylquinazolin-4-one is Cc1ccc2nc(Sc3sc(N)nc3C)n(-c3ccc(Cl)cc3)c(=O)c2c1.
What is the InChIKey of 2-[(2-amino-4-methyl-1,3-thiazol-5-yl)sulfanyl]-3-(4-chlorophenyl)-6-methylquinazolin-4-one?
The InChIKey is PHYUFIRNNLULLS-UHFFFAOYSA-N. The full InChI is InChI=1S/C19H15ClN4OS2/c1-10-3-8-15-14(9-10)16(25)24(13-6-4-12(20)5-7-13)19(23-15)27-17-11(2)22-18(21)26-17/h3-9H,1-2H3,(H2,21,22).
What are the key properties of 2-[(2-amino-4-methyl-1,3-thiazol-5-yl)sulfanyl]-3-(4-chlorophenyl)-6-methylquinazolin-4-one?
2-[(2-amino-4-methyl-1,3-thiazol-5-yl)sulfanyl]-3-(4-chlorophenyl)-6-methylquinazolin-4-one has a molecular weight of 414.94 g/mol, XLogP of 4.85, 3 rotatable bonds, 1 hydrogen bond donors, and 7 hydrogen bond acceptors.
Where does this data come from?
All data for 2-[(2-amino-4-methyl-1,3-thiazol-5-yl)sulfanyl]-3-(4-chlorophenyl)-6-methylquinazolin-4-one is sourced from PubChem (CID 118711923), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).