C21H31NO6 — CID 118711959
(2E,4E)-6-[(2S,3S,5R,6R)-5-[[(Z,4S)-4-acetyloxypent-2-enoyl]amino]-3,6-dimethyloxan-2-yl]-4-methylhexa-2,4-dienoic acid (PubChem CID 118711959) has the molecular formula C21H31NO6 and a molecular weight of 393.48 g/mol. Its IUPAC name is (2E,4E)-6-[(2S,3S,5R,6R)-5-[[(Z,4S)-4-acetyloxypent-2-enoyl]amino]-3,6-dimethyloxan-2-yl]-4-methylhexa-2,4-dienoic acid.
| Compound Name | (2E,4E)-6-[(2S,3S,5R,6R)-5-[[(Z,4S)-4-acetyloxypent-2-enoyl]amino]-3,6-dimethyloxan-2-yl]-4-methylhexa-2,4-dienoic acid |
|---|---|
| PubChem CID | 118711959 |
| Molecular Formula | C21H31NO6 |
| Molecular Weight | 393.48 g/mol |
| Exact Mass | 393.22 |
| IUPAC Name | (2E,4E)-6-[(2S,3S,5R,6R)-5-[[(Z,4S)-4-acetyloxypent-2-enoyl]amino]-3,6-dimethyloxan-2-yl]-4-methylhexa-2,4-dienoic acid |
| SMILES | CC(=O)O[C@@H](C)/C=C\C(=O)N[C@@H]1C[C@H](C)[C@H](C/C=C(C)/C=C/C(=O)O)O[C@@H]1C |
| InChI | InChI=1S/C21H31NO6/c1-13(7-11-21(25)26)6-9-19-14(2)12-18(16(4)28-19)22-20(24)10-8-15(3)27-17(5)23/h6-8,10-11,14-16,18-19H,9,12H2,1-5H3,(H,22,24)(H,25,26)/b10-8-,11-7+,13-6+/t14-,15-,16+,18+,19-/m0/s1 |
| InChIKey | SPJBXWLUCQGFSA-OGGYWXJKSA-N |
| XLogP | 2.77 |
| TPSA | 101.93 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 393.48 |
| LogP ≤ 5 | 2.77 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|