C25H28N4O6 — CID 118711969
4-[2-[[4-(4-ethoxycarbonyl-3,5-dimethylpyrazol-1-yl)phenyl]carbamoylamino]phenoxy]butanoic acid (PubChem CID 118711969) has the molecular formula C25H28N4O6 and a molecular weight of 480.52 g/mol. Its IUPAC name is 4-[2-[[4-(4-ethoxycarbonyl-3,5-dimethylpyrazol-1-yl)phenyl]carbamoylamino]phenoxy]butanoic acid.
| Compound Name | 4-[2-[[4-(4-ethoxycarbonyl-3,5-dimethylpyrazol-1-yl)phenyl]carbamoylamino]phenoxy]butanoic acid |
|---|---|
| PubChem CID | 118711969 |
| Molecular Formula | C25H28N4O6 |
| Molecular Weight | 480.52 g/mol |
| Exact Mass | 480.20 |
| IUPAC Name | 4-[2-[[4-(4-ethoxycarbonyl-3,5-dimethylpyrazol-1-yl)phenyl]carbamoylamino]phenoxy]butanoic acid |
| SMILES | CCOC(=O)c1c(C)nn(-c2ccc(NC(=O)Nc3ccccc3OCCCC(=O)O)cc2)c1C |
| InChI | InChI=1S/C25H28N4O6/c1-4-34-24(32)23-16(2)28-29(17(23)3)19-13-11-18(12-14-19)26-25(33)27-20-8-5-6-9-21(20)35-15-7-10-22(30)31/h5-6,8-9,11-14H,4,7,10,15H2,1-3H3,(H,30,31)(H2,26,27,33) |
| InChIKey | LFEWYQFVCZSKMH-UHFFFAOYSA-N |
| XLogP | 4.55 |
| TPSA | 131.78 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 35 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 480.52 |
| LogP ≤ 5 | 4.55 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|