About 3-butyl-3H-indol-2-amine;hydrochloride
3-butyl-3H-indol-2-amine;hydrochloride (PubChem CID 118711981) has the molecular formula C12H17ClN2
and a molecular weight of 224.74 g/mol. Its IUPAC name is 3-butyl-3H-indol-2-amine;hydrochloride.
Molecular Properties
| Compound Name | 3-butyl-3H-indol-2-amine;hydrochloride |
| PubChem CID | 118711981 |
| Molecular Formula | C12H17ClN2 |
| Molecular Weight | 224.74 g/mol |
| Exact Mass | 224.11 |
| IUPAC Name | 3-butyl-3H-indol-2-amine;hydrochloride |
| SMILES | CCCCC1C(N)=Nc2ccccc21.Cl |
| InChI | InChI=1S/C12H16N2.ClH/c1-2-3-6-10-9-7-4-5-8-11(9)14-12(10)13;/h4-5,7-8,10H,2-3,6H2,1H3,(H2,13,14);1H |
| InChIKey | YWHVYBSQYVGNME-UHFFFAOYSA-N |
| XLogP | 3.38 |
| TPSA | 38.38 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 15 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 224.74 |
| LogP ≤ 5 | 3.38 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze 3-butyl-3H-indol-2-amine;hydrochloride with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3-butyl-3H-indol-2-amine;hydrochloride?
The IUPAC name of 3-butyl-3H-indol-2-amine;hydrochloride (CID 118711981) is 3-butyl-3H-indol-2-amine;hydrochloride.
What is the SMILES notation for 3-butyl-3H-indol-2-amine;hydrochloride?
The canonical SMILES for 3-butyl-3H-indol-2-amine;hydrochloride is CCCCC1C(N)=Nc2ccccc21.Cl.
What is the InChIKey of 3-butyl-3H-indol-2-amine;hydrochloride?
The InChIKey is YWHVYBSQYVGNME-UHFFFAOYSA-N. The full InChI is InChI=1S/C12H16N2.ClH/c1-2-3-6-10-9-7-4-5-8-11(9)14-12(10)13;/h4-5,7-8,10H,2-3,6H2,1H3,(H2,13,14);1H.
What are the key properties of 3-butyl-3H-indol-2-amine;hydrochloride?
3-butyl-3H-indol-2-amine;hydrochloride has a molecular weight of 224.74 g/mol, XLogP of 3.38, 3 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 3-butyl-3H-indol-2-amine;hydrochloride is sourced from PubChem (CID 118711981), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).