C18H17F10N3O2 — CID 118712051
1-[4-(1,1,1,2,3,3,3-heptafluoropropan-2-yl)phenyl]-3-[1-(3,3,3-trifluoropropanoyl)piperidin-4-yl]urea (PubChem CID 118712051) has the molecular formula C18H17F10N3O2 and a molecular weight of 497.33 g/mol. Its IUPAC name is 1-[4-(1,1,1,2,3,3,3-heptafluoropropan-2-yl)phenyl]-3-[1-(3,3,3-trifluoropropanoyl)piperidin-4-yl]urea.
| Compound Name | 1-[4-(1,1,1,2,3,3,3-heptafluoropropan-2-yl)phenyl]-3-[1-(3,3,3-trifluoropropanoyl)piperidin-4-yl]urea |
|---|---|
| PubChem CID | 118712051 |
| Molecular Formula | C18H17F10N3O2 |
| Molecular Weight | 497.33 g/mol |
| Exact Mass | 497.12 |
| IUPAC Name | 1-[4-(1,1,1,2,3,3,3-heptafluoropropan-2-yl)phenyl]-3-[1-(3,3,3-trifluoropropanoyl)piperidin-4-yl]urea |
| SMILES | O=C(Nc1ccc(C(F)(C(F)(F)F)C(F)(F)F)cc1)NC1CCN(C(=O)CC(F)(F)F)CC1 |
| InChI | InChI=1S/C18H17F10N3O2/c19-15(20,21)9-13(32)31-7-5-12(6-8-31)30-14(33)29-11-3-1-10(2-4-11)16(22,17(23,24)25)18(26,27)28/h1-4,12H,5-9H2,(H2,29,30,33) |
| InChIKey | IFGICALNZMQBET-UHFFFAOYSA-N |
| XLogP | 5.04 |
| TPSA | 61.44 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 497.33 |
| LogP ≤ 5 | 5.04 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |