C14H21NO2 — CID 118712103
(2R,3R,4R,6R)-6-(2-hydroxyethyl)-3-methyl-2-phenylpiperidin-4-ol (PubChem CID 118712103) has the molecular formula C14H21NO2 and a molecular weight of 235.33 g/mol. Its IUPAC name is (2R,3R,4R,6R)-6-(2-hydroxyethyl)-3-methyl-2-phenylpiperidin-4-ol.
| Compound Name | (2R,3R,4R,6R)-6-(2-hydroxyethyl)-3-methyl-2-phenylpiperidin-4-ol |
|---|---|
| PubChem CID | 118712103 |
| Molecular Formula | C14H21NO2 |
| Molecular Weight | 235.33 g/mol |
| Exact Mass | 235.16 |
| IUPAC Name | (2R,3R,4R,6R)-6-(2-hydroxyethyl)-3-methyl-2-phenylpiperidin-4-ol |
| SMILES | C[C@H]1[C@H](O)C[C@@H](CCO)N[C@H]1c1ccccc1 |
| InChI | InChI=1S/C14H21NO2/c1-10-13(17)9-12(7-8-16)15-14(10)11-5-3-2-4-6-11/h2-6,10,12-17H,7-9H2,1H3/t10-,12+,13+,14+/m0/s1 |
| InChIKey | GKCVEUIXYSHDJP-IGHBBLSQSA-N |
| XLogP | 1.47 |
| TPSA | 52.49 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 235.33 |
| LogP ≤ 5 | 1.47 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |