C23H24N8O2 — CID 118712326
5,13-bis[2-(1,2,4-triazol-1-yl)ethoxy]-1,9-diazatetracyclo[7.7.1.02,7.010,15]heptadeca-2(7),3,5,10(15),11,13-hexaene (PubChem CID 118712326) has the molecular formula C23H24N8O2 and a molecular weight of 444.50 g/mol. Its IUPAC name is 5,13-bis[2-(1,2,4-triazol-1-yl)ethoxy]-1,9-diazatetracyclo[7.7.1.02,7.010,15]heptadeca-2(7),3,5,10(15),11,13-hexaene.
| Compound Name | 5,13-bis[2-(1,2,4-triazol-1-yl)ethoxy]-1,9-diazatetracyclo[7.7.1.02,7.010,15]heptadeca-2(7),3,5,10(15),11,13-hexaene |
|---|---|
| PubChem CID | 118712326 |
| Molecular Formula | C23H24N8O2 |
| Molecular Weight | 444.50 g/mol |
| Exact Mass | 444.20 |
| IUPAC Name | 5,13-bis[2-(1,2,4-triazol-1-yl)ethoxy]-1,9-diazatetracyclo[7.7.1.02,7.010,15]heptadeca-2(7),3,5,10(15),11,13-hexaene |
| SMILES | c1ncn(CCOc2ccc3c(c2)CN2CN3Cc3cc(OCCn4cncn4)ccc32)n1 |
| InChI | InChI=1S/C23H24N8O2/c1-3-22-18(9-20(1)32-7-5-30-15-24-13-26-30)11-29-17-28(22)12-19-10-21(2-4-23(19)29)33-8-6-31-16-25-14-27-31/h1-4,9-10,13-16H,5-8,11-12,17H2 |
| InChIKey | ADLBICVZLFSTQS-UHFFFAOYSA-N |
| XLogP | 2.33 |
| TPSA | 86.36 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 444.50 |
| LogP ≤ 5 | 2.33 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'anil_di_alk_C(246)', 'substructure': 'N/A'} |
|---|