C13H16ClNO — CID 118712367
7-chloro-8-methoxy-2,3,4,4a,5,9b-hexahydro-1H-indeno[1,2-b]pyridine (PubChem CID 118712367) has the molecular formula C13H16ClNO and a molecular weight of 237.73 g/mol. Its IUPAC name is 7-chloro-8-methoxy-2,3,4,4a,5,9b-hexahydro-1H-indeno[1,2-b]pyridine.
| Compound Name | 7-chloro-8-methoxy-2,3,4,4a,5,9b-hexahydro-1H-indeno[1,2-b]pyridine |
|---|---|
| PubChem CID | 118712367 |
| Molecular Formula | C13H16ClNO |
| Molecular Weight | 237.73 g/mol |
| Exact Mass | 237.09 |
| IUPAC Name | 7-chloro-8-methoxy-2,3,4,4a,5,9b-hexahydro-1H-indeno[1,2-b]pyridine |
| SMILES | COc1cc2c(cc1Cl)CC1CCCNC21 |
| InChI | InChI=1S/C13H16ClNO/c1-16-12-7-10-9(6-11(12)14)5-8-3-2-4-15-13(8)10/h6-8,13,15H,2-5H2,1H3 |
| InChIKey | NEDNGBQPORHEBS-UHFFFAOYSA-N |
| XLogP | 2.95 |
| TPSA | 21.26 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 237.73 |
| LogP ≤ 5 | 2.95 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |