C24H32O5S — CID 118712548
[1-[4-[(E)-2-(3,5-dimethoxyphenyl)ethenyl]phenyl]-4,4-dimethylpentan-3-yl] methanesulfonate (PubChem CID 118712548) has the molecular formula C24H32O5S and a molecular weight of 432.58 g/mol. Its IUPAC name is [1-[4-[(E)-2-(3,5-dimethoxyphenyl)ethenyl]phenyl]-4,4-dimethylpentan-3-yl] methanesulfonate.
| Compound Name | [1-[4-[(E)-2-(3,5-dimethoxyphenyl)ethenyl]phenyl]-4,4-dimethylpentan-3-yl] methanesulfonate |
|---|---|
| PubChem CID | 118712548 |
| Molecular Formula | C24H32O5S |
| Molecular Weight | 432.58 g/mol |
| Exact Mass | 432.20 |
| IUPAC Name | [1-[4-[(E)-2-(3,5-dimethoxyphenyl)ethenyl]phenyl]-4,4-dimethylpentan-3-yl] methanesulfonate |
| SMILES | COc1cc(/C=C/c2ccc(CCC(OS(C)(=O)=O)C(C)(C)C)cc2)cc(OC)c1 |
| InChI | InChI=1S/C24H32O5S/c1-24(2,3)23(29-30(6,25)26)14-13-19-9-7-18(8-10-19)11-12-20-15-21(27-4)17-22(16-20)28-5/h7-12,15-17,23H,13-14H2,1-6H3/b12-11+ |
| InChIKey | ZSIANVFNRRYAFE-VAWYXSNFSA-N |
| XLogP | 5.20 |
| TPSA | 61.83 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 432.58 |
| LogP ≤ 5 | 5.20 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'stilbene', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_1', 'substructure': 'N/A'} |
|---|