C30H36O5S — CID 118712549
[1-[4-[(E)-2-(3,5-dimethoxyphenyl)ethenyl]phenyl]-4,4-dimethylpentan-3-yl] 4-methylbenzenesulfonate (PubChem CID 118712549) has the molecular formula C30H36O5S and a molecular weight of 508.68 g/mol. Its IUPAC name is [1-[4-[(E)-2-(3,5-dimethoxyphenyl)ethenyl]phenyl]-4,4-dimethylpentan-3-yl] 4-methylbenzenesulfonate.
| Compound Name | [1-[4-[(E)-2-(3,5-dimethoxyphenyl)ethenyl]phenyl]-4,4-dimethylpentan-3-yl] 4-methylbenzenesulfonate |
|---|---|
| PubChem CID | 118712549 |
| Molecular Formula | C30H36O5S |
| Molecular Weight | 508.68 g/mol |
| Exact Mass | 508.23 |
| IUPAC Name | [1-[4-[(E)-2-(3,5-dimethoxyphenyl)ethenyl]phenyl]-4,4-dimethylpentan-3-yl] 4-methylbenzenesulfonate |
| SMILES | COc1cc(/C=C/c2ccc(CCC(OS(=O)(=O)c3ccc(C)cc3)C(C)(C)C)cc2)cc(OC)c1 |
| InChI | InChI=1S/C30H36O5S/c1-22-7-16-28(17-8-22)36(31,32)35-29(30(2,3)4)18-15-24-11-9-23(10-12-24)13-14-25-19-26(33-5)21-27(20-25)34-6/h7-14,16-17,19-21,29H,15,18H2,1-6H3/b14-13+ |
| InChIKey | KZLMSTWEFNEKMF-BUHFOSPRSA-N |
| XLogP | 6.94 |
| TPSA | 61.83 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 36 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 508.68 |
| LogP ≤ 5 | 6.94 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'stilbene', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_1', 'substructure': 'N/A'} |
|---|