C21H26FN3O4 — CID 118712584
(2S)-1-[(2R)-2-(cyclopentylmethyl)-3-[formyl(hydroxy)amino]propanoyl]-N-(4-fluorophenyl)-2,5-dihydropyrrole-2-carboxamide (PubChem CID 118712584) has the molecular formula C21H26FN3O4 and a molecular weight of 403.45 g/mol. Its IUPAC name is (2S)-1-[(2R)-2-(cyclopentylmethyl)-3-[formyl(hydroxy)amino]propanoyl]-N-(4-fluorophenyl)-2,5-dihydropyrrole-2-carboxamide.
| Compound Name | (2S)-1-[(2R)-2-(cyclopentylmethyl)-3-[formyl(hydroxy)amino]propanoyl]-N-(4-fluorophenyl)-2,5-dihydropyrrole-2-carboxamide |
|---|---|
| PubChem CID | 118712584 |
| Molecular Formula | C21H26FN3O4 |
| Molecular Weight | 403.45 g/mol |
| Exact Mass | 403.19 |
| IUPAC Name | (2S)-1-[(2R)-2-(cyclopentylmethyl)-3-[formyl(hydroxy)amino]propanoyl]-N-(4-fluorophenyl)-2,5-dihydropyrrole-2-carboxamide |
| SMILES | O=CN(O)C[C@@H](CC1CCCC1)C(=O)N1CC=C[C@H]1C(=O)Nc1ccc(F)cc1 |
| InChI | InChI=1S/C21H26FN3O4/c22-17-7-9-18(10-8-17)23-20(27)19-6-3-11-25(19)21(28)16(13-24(29)14-26)12-15-4-1-2-5-15/h3,6-10,14-16,19,29H,1-2,4-5,11-13H2,(H,23,27)/t16-,19+/m1/s1 |
| InChIKey | OVFGKJCMTHMTGG-APWZRJJASA-N |
| XLogP | 2.58 |
| TPSA | 89.95 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 403.45 |
| LogP ≤ 5 | 2.58 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'hydroxamic_acid', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|