C20H30N4O4S — CID 118712594
(2S,4S)-1-[(2R)-2-(cyclopentylmethyl)-3-[formyl(hydroxy)amino]propanoyl]-4-methyl-N-(5-methyl-1,3-thiazol-2-yl)pyrrolidine-2-carboxamide (PubChem CID 118712594) has the molecular formula C20H30N4O4S and a molecular weight of 422.55 g/mol. Its IUPAC name is (2S,4S)-1-[(2R)-2-(cyclopentylmethyl)-3-[formyl(hydroxy)amino]propanoyl]-4-methyl-N-(5-methyl-1,3-thiazol-2-yl)pyrrolidine-2-carboxamide.
| Compound Name | (2S,4S)-1-[(2R)-2-(cyclopentylmethyl)-3-[formyl(hydroxy)amino]propanoyl]-4-methyl-N-(5-methyl-1,3-thiazol-2-yl)pyrrolidine-2-carboxamide |
|---|---|
| PubChem CID | 118712594 |
| Molecular Formula | C20H30N4O4S |
| Molecular Weight | 422.55 g/mol |
| Exact Mass | 422.20 |
| IUPAC Name | (2S,4S)-1-[(2R)-2-(cyclopentylmethyl)-3-[formyl(hydroxy)amino]propanoyl]-4-methyl-N-(5-methyl-1,3-thiazol-2-yl)pyrrolidine-2-carboxamide |
| SMILES | Cc1cnc(NC(=O)[C@@H]2C[C@H](C)CN2C(=O)[C@H](CC2CCCC2)CN(O)C=O)s1 |
| InChI | InChI=1S/C20H30N4O4S/c1-13-7-17(18(26)22-20-21-9-14(2)29-20)24(10-13)19(27)16(11-23(28)12-25)8-15-5-3-4-6-15/h9,12-13,15-17,28H,3-8,10-11H2,1-2H3,(H,21,22,26)/t13-,16+,17-/m0/s1 |
| InChIKey | CYIRKSOICNWITB-XKQJLSEDSA-N |
| XLogP | 2.67 |
| TPSA | 102.84 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 422.55 |
| LogP ≤ 5 | 2.67 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'hydroxamic_acid', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|