About (E)-3-[4-[2-(1,2-dimethylindol-3-yl)ethylsulfamoyl]phenyl]-N-hydroxyprop-2-enamide
(E)-3-[4-[2-(1,2-dimethylindol-3-yl)ethylsulfamoyl]phenyl]-N-hydroxyprop-2-enamide (PubChem CID 118712700) has the molecular formula C21H23N3O4S
and a molecular weight of 413.50 g/mol. Its IUPAC name is (E)-3-[4-[2-(1,2-dimethylindol-3-yl)ethylsulfamoyl]phenyl]-N-hydroxyprop-2-enamide.
Molecular Properties
| Compound Name | (E)-3-[4-[2-(1,2-dimethylindol-3-yl)ethylsulfamoyl]phenyl]-N-hydroxyprop-2-enamide |
| PubChem CID | 118712700 |
| Molecular Formula | C21H23N3O4S |
| Molecular Weight | 413.50 g/mol |
| Exact Mass | 413.14 |
| IUPAC Name | (E)-3-[4-[2-(1,2-dimethylindol-3-yl)ethylsulfamoyl]phenyl]-N-hydroxyprop-2-enamide |
| SMILES | Cc1c(CCNS(=O)(=O)c2ccc(/C=C/C(=O)NO)cc2)c2ccccc2n1C |
| InChI | InChI=1S/C21H23N3O4S/c1-15-18(19-5-3-4-6-20(19)24(15)2)13-14-22-29(27,28)17-10-7-16(8-11-17)9-12-21(25)23-26/h3-12,22,26H,13-14H2,1-2H3,(H,23,25)/b12-9+ |
| InChIKey | HBBFWMSCYPNIJW-FMIVXFBMSA-N |
| XLogP | 2.53 |
| TPSA | 100.43 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 29 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 413.50 |
| LogP ≤ 5 | 2.53 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'indol_3yl_alk(461)', 'substructure': 'N/A'}, {'alert_name': 'hydroxamic_acid', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|
Analyze (E)-3-[4-[2-(1,2-dimethylindol-3-yl)ethylsulfamoyl]phenyl]-N-hydroxyprop-2-enamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (E)-3-[4-[2-(1,2-dimethylindol-3-yl)ethylsulfamoyl]phenyl]-N-hydroxyprop-2-enamide?
The IUPAC name of (E)-3-[4-[2-(1,2-dimethylindol-3-yl)ethylsulfamoyl]phenyl]-N-hydroxyprop-2-enamide (CID 118712700) is (E)-3-[4-[2-(1,2-dimethylindol-3-yl)ethylsulfamoyl]phenyl]-N-hydroxyprop-2-enamide.
What is the SMILES notation for (E)-3-[4-[2-(1,2-dimethylindol-3-yl)ethylsulfamoyl]phenyl]-N-hydroxyprop-2-enamide?
The canonical SMILES for (E)-3-[4-[2-(1,2-dimethylindol-3-yl)ethylsulfamoyl]phenyl]-N-hydroxyprop-2-enamide is Cc1c(CCNS(=O)(=O)c2ccc(/C=C/C(=O)NO)cc2)c2ccccc2n1C.
What is the InChIKey of (E)-3-[4-[2-(1,2-dimethylindol-3-yl)ethylsulfamoyl]phenyl]-N-hydroxyprop-2-enamide?
The InChIKey is HBBFWMSCYPNIJW-FMIVXFBMSA-N. The full InChI is InChI=1S/C21H23N3O4S/c1-15-18(19-5-3-4-6-20(19)24(15)2)13-14-22-29(27,28)17-10-7-16(8-11-17)9-12-21(25)23-26/h3-12,22,26H,13-14H2,1-2H3,(H,23,25)/b12-9+.
What are the key properties of (E)-3-[4-[2-(1,2-dimethylindol-3-yl)ethylsulfamoyl]phenyl]-N-hydroxyprop-2-enamide?
(E)-3-[4-[2-(1,2-dimethylindol-3-yl)ethylsulfamoyl]phenyl]-N-hydroxyprop-2-enamide has a molecular weight of 413.50 g/mol, XLogP of 2.53, 7 rotatable bonds, 3 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for (E)-3-[4-[2-(1,2-dimethylindol-3-yl)ethylsulfamoyl]phenyl]-N-hydroxyprop-2-enamide is sourced from PubChem (CID 118712700), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).