C20H19N3O4S — CID 118712710
(E)-N-hydroxy-3-[4-(1,3,4,9-tetrahydropyrido[3,4-b]indol-2-ylsulfonyl)phenyl]prop-2-enamide (PubChem CID 118712710) has the molecular formula C20H19N3O4S and a molecular weight of 397.46 g/mol. Its IUPAC name is (E)-N-hydroxy-3-[4-(1,3,4,9-tetrahydropyrido[3,4-b]indol-2-ylsulfonyl)phenyl]prop-2-enamide.
| Compound Name | (E)-N-hydroxy-3-[4-(1,3,4,9-tetrahydropyrido[3,4-b]indol-2-ylsulfonyl)phenyl]prop-2-enamide |
|---|---|
| PubChem CID | 118712710 |
| Molecular Formula | C20H19N3O4S |
| Molecular Weight | 397.46 g/mol |
| Exact Mass | 397.11 |
| IUPAC Name | (E)-N-hydroxy-3-[4-(1,3,4,9-tetrahydropyrido[3,4-b]indol-2-ylsulfonyl)phenyl]prop-2-enamide |
| SMILES | O=C(/C=C/c1ccc(S(=O)(=O)N2CCc3c([nH]c4ccccc34)C2)cc1)NO |
| InChI | InChI=1S/C20H19N3O4S/c24-20(22-25)10-7-14-5-8-15(9-6-14)28(26,27)23-12-11-17-16-3-1-2-4-18(16)21-19(17)13-23/h1-10,21,25H,11-13H2,(H,22,24)/b10-7+ |
| InChIKey | QXEPENIGNIKVLB-JXMROGBWSA-N |
| XLogP | 2.43 |
| TPSA | 102.50 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 397.46 |
| LogP ≤ 5 | 2.43 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'indol_3yl_alk(461)', 'substructure': 'N/A'}, {'alert_name': 'hydroxamic_acid', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|