About 2-[4-[(Z)-4-chloro-1,2-diphenylbut-1-enyl]phenoxy]ethyl methanesulfonate
2-[4-[(Z)-4-chloro-1,2-diphenylbut-1-enyl]phenoxy]ethyl methanesulfonate (PubChem CID 118712742) has the molecular formula C25H25ClO4S
and a molecular weight of 456.99 g/mol. Its IUPAC name is 2-[4-[(Z)-4-chloro-1,2-diphenylbut-1-enyl]phenoxy]ethyl methanesulfonate.
Molecular Properties
| Compound Name | 2-[4-[(Z)-4-chloro-1,2-diphenylbut-1-enyl]phenoxy]ethyl methanesulfonate |
| PubChem CID | 118712742 |
| Molecular Formula | C25H25ClO4S |
| Molecular Weight | 456.99 g/mol |
| Exact Mass | 456.12 |
| IUPAC Name | 2-[4-[(Z)-4-chloro-1,2-diphenylbut-1-enyl]phenoxy]ethyl methanesulfonate |
| SMILES | CS(=O)(=O)OCCOc1ccc(/C(=C(/CCCl)c2ccccc2)c2ccccc2)cc1 |
| InChI | InChI=1S/C25H25ClO4S/c1-31(27,28)30-19-18-29-23-14-12-22(13-15-23)25(21-10-6-3-7-11-21)24(16-17-26)20-8-4-2-5-9-20/h2-15H,16-19H2,1H3/b25-24- |
| InChIKey | MJBPROWMPHUIAA-IZHYLOQSSA-N |
| XLogP | 5.63 |
| TPSA | 52.60 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 31 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 456.99 |
| LogP ≤ 5 | 5.63 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'stilbene', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_1', 'substructure': 'N/A'} |
|---|
Analyze 2-[4-[(Z)-4-chloro-1,2-diphenylbut-1-enyl]phenoxy]ethyl methanesulfonate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-[4-[(Z)-4-chloro-1,2-diphenylbut-1-enyl]phenoxy]ethyl methanesulfonate?
The IUPAC name of 2-[4-[(Z)-4-chloro-1,2-diphenylbut-1-enyl]phenoxy]ethyl methanesulfonate (CID 118712742) is 2-[4-[(Z)-4-chloro-1,2-diphenylbut-1-enyl]phenoxy]ethyl methanesulfonate.
What is the SMILES notation for 2-[4-[(Z)-4-chloro-1,2-diphenylbut-1-enyl]phenoxy]ethyl methanesulfonate?
The canonical SMILES for 2-[4-[(Z)-4-chloro-1,2-diphenylbut-1-enyl]phenoxy]ethyl methanesulfonate is CS(=O)(=O)OCCOc1ccc(/C(=C(/CCCl)c2ccccc2)c2ccccc2)cc1.
What is the InChIKey of 2-[4-[(Z)-4-chloro-1,2-diphenylbut-1-enyl]phenoxy]ethyl methanesulfonate?
The InChIKey is MJBPROWMPHUIAA-IZHYLOQSSA-N. The full InChI is InChI=1S/C25H25ClO4S/c1-31(27,28)30-19-18-29-23-14-12-22(13-15-23)25(21-10-6-3-7-11-21)24(16-17-26)20-8-4-2-5-9-20/h2-15H,16-19H2,1H3/b25-24-.
What are the key properties of 2-[4-[(Z)-4-chloro-1,2-diphenylbut-1-enyl]phenoxy]ethyl methanesulfonate?
2-[4-[(Z)-4-chloro-1,2-diphenylbut-1-enyl]phenoxy]ethyl methanesulfonate has a molecular weight of 456.99 g/mol, XLogP of 5.63, 10 rotatable bonds, 0 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 2-[4-[(Z)-4-chloro-1,2-diphenylbut-1-enyl]phenoxy]ethyl methanesulfonate is sourced from PubChem (CID 118712742), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).