About 6-(3,5-difluorophenyl)thieno[2,3-b]pyrazine
6-(3,5-difluorophenyl)thieno[2,3-b]pyrazine (PubChem CID 118712790) has the molecular formula C12H6F2N2S
and a molecular weight of 248.26 g/mol. Its IUPAC name is 6-(3,5-difluorophenyl)thieno[2,3-b]pyrazine.
Molecular Properties
| Compound Name | 6-(3,5-difluorophenyl)thieno[2,3-b]pyrazine |
| PubChem CID | 118712790 |
| Molecular Formula | C12H6F2N2S |
| Molecular Weight | 248.26 g/mol |
| Exact Mass | 248.02 |
| IUPAC Name | 6-(3,5-difluorophenyl)thieno[2,3-b]pyrazine |
| SMILES | Fc1cc(F)cc(-c2cc3nccnc3s2)c1 |
| InChI | InChI=1S/C12H6F2N2S/c13-8-3-7(4-9(14)5-8)11-6-10-12(17-11)16-2-1-15-10/h1-6H |
| InChIKey | RBEIGPCKTTVZGY-UHFFFAOYSA-N |
| XLogP | 3.64 |
| TPSA | 25.78 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 17 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 248.26 |
| LogP ≤ 5 | 3.64 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze 6-(3,5-difluorophenyl)thieno[2,3-b]pyrazine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 6-(3,5-difluorophenyl)thieno[2,3-b]pyrazine?
The IUPAC name of 6-(3,5-difluorophenyl)thieno[2,3-b]pyrazine (CID 118712790) is 6-(3,5-difluorophenyl)thieno[2,3-b]pyrazine.
What is the SMILES notation for 6-(3,5-difluorophenyl)thieno[2,3-b]pyrazine?
The canonical SMILES for 6-(3,5-difluorophenyl)thieno[2,3-b]pyrazine is Fc1cc(F)cc(-c2cc3nccnc3s2)c1.
What is the InChIKey of 6-(3,5-difluorophenyl)thieno[2,3-b]pyrazine?
The InChIKey is RBEIGPCKTTVZGY-UHFFFAOYSA-N. The full InChI is InChI=1S/C12H6F2N2S/c13-8-3-7(4-9(14)5-8)11-6-10-12(17-11)16-2-1-15-10/h1-6H.
What are the key properties of 6-(3,5-difluorophenyl)thieno[2,3-b]pyrazine?
6-(3,5-difluorophenyl)thieno[2,3-b]pyrazine has a molecular weight of 248.26 g/mol, XLogP of 3.64, 1 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 6-(3,5-difluorophenyl)thieno[2,3-b]pyrazine is sourced from PubChem (CID 118712790), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).