C24H29N5O2S — CID 118712947
1-[1-[2-(7-methoxy-2-oxo-1,5-naphthyridin-1-yl)ethyl]piperidin-4-yl]-3-(4-methylphenyl)thiourea (PubChem CID 118712947) has the molecular formula C24H29N5O2S and a molecular weight of 451.60 g/mol. Its IUPAC name is 1-[1-[2-(7-methoxy-2-oxo-1,5-naphthyridin-1-yl)ethyl]piperidin-4-yl]-3-(4-methylphenyl)thiourea.
| Compound Name | 1-[1-[2-(7-methoxy-2-oxo-1,5-naphthyridin-1-yl)ethyl]piperidin-4-yl]-3-(4-methylphenyl)thiourea |
|---|---|
| PubChem CID | 118712947 |
| Molecular Formula | C24H29N5O2S |
| Molecular Weight | 451.60 g/mol |
| Exact Mass | 451.20 |
| IUPAC Name | 1-[1-[2-(7-methoxy-2-oxo-1,5-naphthyridin-1-yl)ethyl]piperidin-4-yl]-3-(4-methylphenyl)thiourea |
| SMILES | COc1cnc2ccc(=O)n(CCN3CCC(NC(=S)Nc4ccc(C)cc4)CC3)c2c1 |
| InChI | InChI=1S/C24H29N5O2S/c1-17-3-5-18(6-4-17)26-24(32)27-19-9-11-28(12-10-19)13-14-29-22-15-20(31-2)16-25-21(22)7-8-23(29)30/h3-8,15-16,19H,9-14H2,1-2H3,(H2,26,27,32) |
| InChIKey | KUIGMMIWUABSPI-UHFFFAOYSA-N |
| XLogP | 3.16 |
| TPSA | 71.42 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 451.60 |
| LogP ≤ 5 | 3.16 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|