About trans-(1S,2R)-1-methyl-2-phenylcyclopropan-1-amine;hydrochloride
trans-(1S,2R)-1-methyl-2-phenylcyclopropan-1-amine;hydrochloride (PubChem CID 118712956) has the molecular formula C10H14ClN
and a molecular weight of 183.68 g/mol. Its IUPAC name is trans-(1S,2R)-1-methyl-2-phenylcyclopropan-1-amine;hydrochloride.
Molecular Properties
| Compound Name | trans-(1S,2R)-1-methyl-2-phenylcyclopropan-1-amine;hydrochloride |
| PubChem CID | 118712956 |
| Molecular Formula | C10H14ClN |
| Molecular Weight | 183.68 g/mol |
| Exact Mass | 183.08 |
| IUPAC Name | trans-(1S,2R)-1-methyl-2-phenylcyclopropan-1-amine;hydrochloride |
| SMILES | C[C@]1(N)C[C@@H]1c1ccccc1.Cl |
| InChI | InChI=1S/C10H13N.ClH/c1-10(11)7-9(10)8-5-3-2-4-6-8;/h2-6,9H,7,11H2,1H3;1H/t9-,10+;/m1./s1 |
| InChIKey | ATFVTRDQCBBLIQ-UXQCFNEQSA-N |
| XLogP | 2.31 |
| TPSA | 26.02 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 12 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 183.68 |
| LogP ≤ 5 | 2.31 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
Analyze trans-(1S,2R)-1-methyl-2-phenylcyclopropan-1-amine;hydrochloride with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of trans-(1S,2R)-1-methyl-2-phenylcyclopropan-1-amine;hydrochloride?
The IUPAC name of trans-(1S,2R)-1-methyl-2-phenylcyclopropan-1-amine;hydrochloride (CID 118712956) is trans-(1S,2R)-1-methyl-2-phenylcyclopropan-1-amine;hydrochloride.
What is the SMILES notation for trans-(1S,2R)-1-methyl-2-phenylcyclopropan-1-amine;hydrochloride?
The canonical SMILES for trans-(1S,2R)-1-methyl-2-phenylcyclopropan-1-amine;hydrochloride is C[C@]1(N)C[C@@H]1c1ccccc1.Cl.
What is the InChIKey of trans-(1S,2R)-1-methyl-2-phenylcyclopropan-1-amine;hydrochloride?
The InChIKey is ATFVTRDQCBBLIQ-UXQCFNEQSA-N. The full InChI is InChI=1S/C10H13N.ClH/c1-10(11)7-9(10)8-5-3-2-4-6-8;/h2-6,9H,7,11H2,1H3;1H/t9-,10+;/m1./s1.
What are the key properties of trans-(1S,2R)-1-methyl-2-phenylcyclopropan-1-amine;hydrochloride?
trans-(1S,2R)-1-methyl-2-phenylcyclopropan-1-amine;hydrochloride has a molecular weight of 183.68 g/mol, XLogP of 2.31, 1 rotatable bonds, 1 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for trans-(1S,2R)-1-methyl-2-phenylcyclopropan-1-amine;hydrochloride is sourced from PubChem (CID 118712956), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).