C28H33N3O2 — CID 118712993
N-cyclohexyl-2-(2,5-dimethylphenyl)-10-methyl-3-oxo-4,5-dihydro-1H-azepino[3,4-b]indole-1-carboxamide (PubChem CID 118712993) has the molecular formula C28H33N3O2 and a molecular weight of 443.59 g/mol. Its IUPAC name is N-cyclohexyl-2-(2,5-dimethylphenyl)-10-methyl-3-oxo-4,5-dihydro-1H-azepino[3,4-b]indole-1-carboxamide.
| Compound Name | N-cyclohexyl-2-(2,5-dimethylphenyl)-10-methyl-3-oxo-4,5-dihydro-1H-azepino[3,4-b]indole-1-carboxamide |
|---|---|
| PubChem CID | 118712993 |
| Molecular Formula | C28H33N3O2 |
| Molecular Weight | 443.59 g/mol |
| Exact Mass | 443.26 |
| IUPAC Name | N-cyclohexyl-2-(2,5-dimethylphenyl)-10-methyl-3-oxo-4,5-dihydro-1H-azepino[3,4-b]indole-1-carboxamide |
| SMILES | Cc1ccc(C)c(N2C(=O)CCc3c(n(C)c4ccccc34)C2C(=O)NC2CCCCC2)c1 |
| InChI | InChI=1S/C28H33N3O2/c1-18-13-14-19(2)24(17-18)31-25(32)16-15-22-21-11-7-8-12-23(21)30(3)26(22)27(31)28(33)29-20-9-5-4-6-10-20/h7-8,11-14,17,20,27H,4-6,9-10,15-16H2,1-3H3,(H,29,33) |
| InChIKey | QZLOIHYCBXSWDN-UHFFFAOYSA-N |
| XLogP | 5.26 |
| TPSA | 54.34 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 443.59 |
| LogP ≤ 5 | 5.26 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'indol_3yl_alk(461)', 'substructure': 'N/A'} |
|---|