About [2-amino-4-(2,2-dimethylpropyl)-5-hept-1-ynylthiophen-3-yl]-(4-chlorophenyl)methanone
[2-amino-4-(2,2-dimethylpropyl)-5-hept-1-ynylthiophen-3-yl]-(4-chlorophenyl)methanone (PubChem CID 118713075) has the molecular formula C23H28ClNOS
and a molecular weight of 402.00 g/mol. Its IUPAC name is [2-amino-4-(2,2-dimethylpropyl)-5-hept-1-ynylthiophen-3-yl]-(4-chlorophenyl)methanone.
Molecular Properties
| Compound Name | [2-amino-4-(2,2-dimethylpropyl)-5-hept-1-ynylthiophen-3-yl]-(4-chlorophenyl)methanone |
| PubChem CID | 118713075 |
| Molecular Formula | C23H28ClNOS |
| Molecular Weight | 402.00 g/mol |
| Exact Mass | 401.16 |
| IUPAC Name | [2-amino-4-(2,2-dimethylpropyl)-5-hept-1-ynylthiophen-3-yl]-(4-chlorophenyl)methanone |
| SMILES | CCCCCC#Cc1sc(N)c(C(=O)c2ccc(Cl)cc2)c1CC(C)(C)C |
| InChI | InChI=1S/C23H28ClNOS/c1-5-6-7-8-9-10-19-18(15-23(2,3)4)20(22(25)27-19)21(26)16-11-13-17(24)14-12-16/h11-14H,5-8,15,25H2,1-4H3 |
| InChIKey | CZLLVPFIEJSVLE-UHFFFAOYSA-N |
| XLogP | 6.74 |
| TPSA | 43.09 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 27 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 402.00 |
| LogP ≤ 5 | 6.74 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'thiophene_amino_Aa(45)', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|
Analyze [2-amino-4-(2,2-dimethylpropyl)-5-hept-1-ynylthiophen-3-yl]-(4-chlorophenyl)methanone with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of [2-amino-4-(2,2-dimethylpropyl)-5-hept-1-ynylthiophen-3-yl]-(4-chlorophenyl)methanone?
The IUPAC name of [2-amino-4-(2,2-dimethylpropyl)-5-hept-1-ynylthiophen-3-yl]-(4-chlorophenyl)methanone (CID 118713075) is [2-amino-4-(2,2-dimethylpropyl)-5-hept-1-ynylthiophen-3-yl]-(4-chlorophenyl)methanone.
What is the SMILES notation for [2-amino-4-(2,2-dimethylpropyl)-5-hept-1-ynylthiophen-3-yl]-(4-chlorophenyl)methanone?
The canonical SMILES for [2-amino-4-(2,2-dimethylpropyl)-5-hept-1-ynylthiophen-3-yl]-(4-chlorophenyl)methanone is CCCCCC#Cc1sc(N)c(C(=O)c2ccc(Cl)cc2)c1CC(C)(C)C.
What is the InChIKey of [2-amino-4-(2,2-dimethylpropyl)-5-hept-1-ynylthiophen-3-yl]-(4-chlorophenyl)methanone?
The InChIKey is CZLLVPFIEJSVLE-UHFFFAOYSA-N. The full InChI is InChI=1S/C23H28ClNOS/c1-5-6-7-8-9-10-19-18(15-23(2,3)4)20(22(25)27-19)21(26)16-11-13-17(24)14-12-16/h11-14H,5-8,15,25H2,1-4H3.
What are the key properties of [2-amino-4-(2,2-dimethylpropyl)-5-hept-1-ynylthiophen-3-yl]-(4-chlorophenyl)methanone?
[2-amino-4-(2,2-dimethylpropyl)-5-hept-1-ynylthiophen-3-yl]-(4-chlorophenyl)methanone has a molecular weight of 402.00 g/mol, XLogP of 6.74, 6 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for [2-amino-4-(2,2-dimethylpropyl)-5-hept-1-ynylthiophen-3-yl]-(4-chlorophenyl)methanone is sourced from PubChem (CID 118713075), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).