C33H30N2O9 — CID 118713111
7,17-dihydroxy-12-(4-hydroxy-3-methoxyphenyl)-8,16-dimethoxy-6-(morpholin-4-ylmethyl)-4-oxa-1-azapentacyclo[11.8.0.02,11.05,10.014,19]henicosa-2(11),5,7,9,12,14,16,18,20-nonaen-3-one (PubChem CID 118713111) has the molecular formula C33H30N2O9 and a molecular weight of 598.61 g/mol. Its IUPAC name is 7,17-dihydroxy-12-(4-hydroxy-3-methoxyphenyl)-8,16-dimethoxy-6-(morpholin-4-ylmethyl)-4-oxa-1-azapentacyclo[11.8.0.02,11.05,10.014,19]henicosa-2(11),5,7,9,12,14,16,18,20-nonaen-3-one.
| Compound Name | 7,17-dihydroxy-12-(4-hydroxy-3-methoxyphenyl)-8,16-dimethoxy-6-(morpholin-4-ylmethyl)-4-oxa-1-azapentacyclo[11.8.0.02,11.05,10.014,19]henicosa-2(11),5,7,9,12,14,16,18,20-nonaen-3-one |
|---|---|
| PubChem CID | 118713111 |
| Molecular Formula | C33H30N2O9 |
| Molecular Weight | 598.61 g/mol |
| Exact Mass | 598.20 |
| IUPAC Name | 7,17-dihydroxy-12-(4-hydroxy-3-methoxyphenyl)-8,16-dimethoxy-6-(morpholin-4-ylmethyl)-4-oxa-1-azapentacyclo[11.8.0.02,11.05,10.014,19]henicosa-2(11),5,7,9,12,14,16,18,20-nonaen-3-one |
| SMILES | COc1cc(-c2c3c4cc(OC)c(O)c(CN5CCOCC5)c4oc(=O)c3n3ccc4cc(O)c(OC)cc4c23)ccc1O |
| InChI | InChI=1S/C33H30N2O9/c1-40-24-13-18(4-5-22(24)36)27-28-20-15-26(42-3)31(38)21(16-34-8-10-43-11-9-34)32(20)44-33(39)30(28)35-7-6-17-12-23(37)25(41-2)14-19(17)29(27)35/h4-7,12-15,36-38H,8-11,16H2,1-3H3 |
| InChIKey | NGBFCTJKNMSUCW-UHFFFAOYSA-N |
| XLogP | 4.99 |
| TPSA | 135.47 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 11 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 44 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 598.61 |
| LogP ≤ 5 | 4.99 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 11 |
| Structural Alerts | {'alert_name': 'mannich_A(296)', 'substructure': 'N/A'}, {'alert_name': 'cumarine', 'substructure': 'N/A'} |
|---|