C12H15FN2 — CID 118713118
1-(5-fluoro-1H-indol-3-yl)butan-2-amine (PubChem CID 118713118) has the molecular formula C12H15FN2 and a molecular weight of 206.26 g/mol. Its IUPAC name is 1-(5-fluoro-1H-indol-3-yl)butan-2-amine.
| Compound Name | 1-(5-fluoro-1H-indol-3-yl)butan-2-amine |
|---|---|
| PubChem CID | 118713118 |
| Molecular Formula | C12H15FN2 |
| Molecular Weight | 206.26 g/mol |
| Exact Mass | 206.12 |
| IUPAC Name | 1-(5-fluoro-1H-indol-3-yl)butan-2-amine |
| SMILES | CCC(N)Cc1c[nH]c2ccc(F)cc12 |
| InChI | InChI=1S/C12H15FN2/c1-2-10(14)5-8-7-15-12-4-3-9(13)6-11(8)12/h3-4,6-7,10,15H,2,5,14H2,1H3 |
| InChIKey | QGUZSMSUGSSPNJ-UHFFFAOYSA-N |
| XLogP | 2.59 |
| TPSA | 41.81 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 206.26 |
| LogP ≤ 5 | 2.59 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 1 |